![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Aa.wma | 2019-06-02 11:39 | 326K | |
| Acceleration.wma | 2019-06-02 11:39 | 437K | |
| Accent.wma | 2019-06-02 11:39 | 466K | |
| Activity.wma | 2019-06-02 11:39 | 559K | |
| Aerialist.wma | 2019-06-02 11:39 | 629K | |
| Aethereal.wma | 2019-06-02 11:39 | 326K | |
| Affection.wma | 2019-06-02 11:39 | 600K | |
| Africa Vibe.wma | 2019-06-02 11:39 | 419K | |
| Afternoon.wma | 2019-06-02 11:39 | 536K | |
| Ahh Glitch.wma | 2019-06-02 11:39 | 285K | |
| Ahoy.wma | 2019-06-02 11:39 | 227K | |
| Airborne.wma | 2019-06-02 11:39 | 402K | |
| Aires.wma | 2019-06-02 11:39 | 338K | |
| Airy.wma | 2019-06-02 11:39 | 623K | |
| AlKadaab.wma | 2019-06-02 11:39 | 489K | |
| Alablaster.wma | 2019-06-02 11:39 | 600K | |
| Alterna.wma | 2019-06-02 11:39 | 518K | |
| Always Here.wma | 2019-06-02 11:39 | 548K | |
| Amazement.wma | 2019-06-02 11:39 | 69K | |
| Amethyst.wma | 2019-06-02 11:39 | 57K | |
| Angklungs.wma | 2019-06-02 11:39 | 635K | |
| Angle.wma | 2019-06-02 11:39 | 559K | |
| Appearance.wma | 2019-06-02 11:39 | 443K | |
| Applause.wma | 2019-06-02 11:39 | 110K | |
| Applebite.wma | 2019-06-02 11:39 | 63K | |
| Aquamarine.wma | 2019-06-02 11:39 | 93K | |
| Aquamarine Dreams.wma | 2019-06-02 11:39 | 378K | |
| Aqueous.wma | 2019-06-02 11:39 | 483K | |
| Arcade.wma | 2019-06-02 11:39 | 332K | |
| Archipelago.wma | 2019-06-02 11:39 | 635K | |
| Arctic.wma | 2019-06-02 11:39 | 588K | |
| Arpeggios.wma | 2019-06-02 11:39 | 629K | |
| Ask Love.wma | 2019-06-02 11:39 | 530K | |
| Astir.wma | 2019-06-02 11:39 | 448K | |
| Astrosphere.wma | 2019-06-02 11:39 | 285K | |
| Astrum.wma | 2019-06-02 11:39 | 437K | |
| Atmos.wma | 2019-06-02 11:39 | 227K | |
| Axial.wma | 2019-06-02 11:39 | 367K | |
| Axiom.wma | 2019-06-02 11:39 | 513K | |
| Baby Rhino.wma | 2019-06-02 11:39 | 314K | |
| Bach.wma | 2019-06-02 11:39 | 629K | |
| Back Again.wma | 2019-06-02 11:39 | 536K | |
| Backpacker.wma | 2019-06-02 11:39 | 291K | |
| Backwoods.wma | 2019-06-02 11:39 | 518K | |
| Ballerina.wma | 2019-06-02 11:39 | 635K | |
| Bamboo Sound.wma | 2019-06-02 11:39 | 588K | |
| Bamboo String.wma | 2019-06-02 11:39 | 635K | |
| Be Movin'.wma | 2019-06-02 11:39 | 367K | |
| Beach.wma | 2019-06-02 11:39 | 378K | |
| Bedouin.wma | 2019-06-02 11:39 | 495K | |
| Bedrock.wma | 2019-06-02 11:39 | 565K | |
| Beep.wma | 2019-06-02 11:39 | 63K | |
| Beijing Lantern.wma | 2019-06-02 11:39 | 454K | |
| Belly Dance.wma | 2019-06-02 11:39 | 162K | |
| Bicycle.wma | 2019-06-02 11:39 | 215K | |
| Bionic.wma | 2019-06-02 11:39 | 273K | |
| Bird.wma | 2019-06-02 11:39 | 69K | |
| Bird Box.wma | 2019-06-02 11:39 | 244K | |
| Bit Crush.wma | 2019-06-02 11:39 | 285K | |
| Black Hole.wma | 2019-06-02 11:39 | 349K | |
| Blackbird.wma | 2019-06-02 11:39 | 314K | |
| Blank.wma | 2019-06-02 11:39 | 373K | |
| Blip.wma | 2019-06-02 11:39 | 332K | |
| Blom.wma | 2019-06-02 11:39 | 367K | |
| Blossom.wma | 2019-06-02 11:39 | 495K | |
| Blue Curve.wma | 2019-06-02 11:39 | 343K | |
| Blue Ice.wma | 2019-06-02 11:39 | 489K | |
| Blue Pause.wma | 2019-06-02 11:39 | 326K | |
| Blue Series.wma | 2019-06-02 11:39 | 495K | |
| Blue Smoke.wma | 2019-06-02 11:39 | 548K | |
| Bluet.wma | 2019-06-02 11:39 | 273K | |
| Bobble.wma | 2019-06-02 11:39 | 343K | |
| Bold.wma | 2019-06-02 11:39 | 629K | |
| Bonus.wma | 2019-06-02 11:39 | 244K | |
| Botnia.wma | 2019-06-02 11:39 | 180K | |
| Bouganville.wma | 2019-06-02 11:39 | 256K | |
| Bouncey Bounce.wma | 2019-06-02 11:39 | 454K | |
| Bourne.wma | 2019-06-02 11:39 | 349K | |
| Bowl.wma | 2019-06-02 11:39 | 110K | |
| Box.wma | 2019-06-02 11:39 | 594K | |
| Boxes.wma | 2019-06-02 11:39 | 530K | |
| Brache.wma | 2019-06-02 11:39 | 501K | |
| Braindrenelin.wma | 2019-06-02 11:39 | 174K | |
| Break.wma | 2019-06-02 11:39 | 338K | |
| Breakable Beat.wma | 2019-06-02 11:39 | 396K | |
| Breathing.wma | 2019-06-02 11:39 | 559K | |
| Breeze.wma | 2019-06-02 11:39 | 320K | |
| Bridge.wma | 2019-06-02 11:39 | 629K | |
| Bright-Eyed.wma | 2019-06-02 11:39 | 629K | |
| Brikabrak.wma | 2019-06-02 11:39 | 273K | |
| Brill.wma | 2019-06-02 11:39 | 332K | |
| Brilliant.wma | 2019-06-02 11:39 | 186K | |
| Brimful.wma | 2019-06-02 11:39 | 402K | |
| Brittle.wma | 2019-06-02 11:39 | 390K | |
| Broken Tone.wma | 2019-06-02 11:39 | 87K | |
| Brook.wma | 2019-06-02 11:39 | 489K | |
| Brooklet.wma | 2019-06-02 11:39 | 413K | |
| Bubble.wma | 2019-06-02 11:39 | 495K | |
| Budgerigar.wma | 2019-06-02 11:39 | 303K | |
| Bugler.wma | 2019-06-02 11:39 | 168K | |
| Builder.wma | 2019-06-02 11:39 | 308K | |
| Bullfrog.wma | 2019-06-02 11:39 | 81K | |
| Bureau.wma | 2019-06-02 11:39 | 34K | |
| Bustle.wma | 2019-06-02 11:39 | 367K | |
| Butterfly.wma | 2019-06-02 11:39 | 302K | |
| Buzzer.wma | 2019-06-02 11:39 | 69K | |
| Cab.wma | 2019-06-02 11:39 | 75K | |
| Cackle.wma | 2019-06-02 11:39 | 58K | |
| Calendar 1.wma | 2019-06-02 11:39 | 52K | |
| Calendar 2.wma | 2019-06-02 11:39 | 63K | |
| Calendar 3.wma | 2019-06-02 11:39 | 69K | |
| Calendar 4.wma | 2019-06-02 11:39 | 63K | |
| Calendar 5.wma | 2019-06-02 11:39 | 92K | |
| Calendar 6.wma | 2019-06-02 11:39 | 110K | |
| Calendar Cseries.wma | 2019-06-02 11:39 | 116K | |
| Calendar Eseries.wma | 2019-06-02 11:39 | 232K | |
| Calendar Nseries.wma | 2019-06-02 11:39 | 92K | |
| Calendar Xseries.wma | 2019-06-02 11:39 | 98K | |
| Call Waiting.wma | 2019-06-02 11:39 | 378K | |
| Calm.wma | 2019-06-02 11:39 | 297K | |
| Candy.wma | 2019-06-02 11:39 | 75K | |
| Canvas.wma | 2019-06-02 11:39 | 273K | |
| Caprice.wma | 2019-06-02 11:39 | 116K | |
| Captain.wma | 2019-06-02 11:39 | 349K | |
| Cartouche.wma | 2019-06-02 11:39 | 373K | |
| Cascades.wma | 2019-06-02 11:39 | 542K | |
| Cassiterite.wma | 2019-06-02 11:39 | 87K | |
| Cat.wma | 2019-06-02 11:39 | 215K | |
| Catalyst.wma | 2019-06-02 11:39 | 419K | |
| Catwalk.wma | 2019-06-02 11:39 | 349K | |
| Cavalier.wma | 2019-06-02 11:39 | 116K | |
| Celestine.wma | 2019-06-02 11:39 | 338K | |
| Cello.wma | 2019-06-02 11:39 | 577K | |
| Centric.wma | 2019-06-02 11:39 | 361K | |
| Ceramic.wma | 2019-06-02 11:39 | 197K | |
| Certitude.wma | 2019-06-02 11:39 | 588K | |
| Charade.wma | 2019-06-02 11:39 | 326K | |
| Chatter.wma | 2019-06-02 11:39 | 413K | |
| Chicken Dance.wma | 2019-06-02 11:39 | 489K | |
| Chill.wma | 2019-06-02 11:39 | 542K | |
| Chilled.wma | 2019-06-02 11:39 | 291K | |
| Chimera.wma | 2019-06-02 11:39 | 489K | |
| China Spirit.wma | 2019-06-02 11:39 | 361K | |
| Chipper.wma | 2019-06-02 11:39 | 320K | |
| Circle.wma | 2019-06-02 11:39 | 373K | |
| Circles.wma | 2019-06-02 11:39 | 402K | |
| City Life.wma | 2019-06-02 11:39 | 524K | |
| Clari.wma | 2019-06-02 11:39 | 81K | |
| Clarity.wma | 2019-06-02 11:39 | 588K | |
| Classic Chap.wma | 2019-06-02 11:39 | 623K | |
| Clear Blue Sky.wma | 2019-06-02 11:39 | 332K | |
| Clerk.wma | 2019-06-02 11:39 | 75K | |
| Click.wma | 2019-06-02 11:39 | 81K | |
| Clock 1 (1999).wma | 2019-06-02 11:39 | 168K | |
| Clock 1 (2004).wma | 2019-06-02 11:39 | 559K | |
| Clock 1 (2007).wma | 2019-06-02 11:39 | 302K | |
| Clock 1 (2010).wma | 2019-06-02 11:39 | 484K | |
| Clock 1 (2011).wma | 2019-06-02 11:39 | 489K | |
| Clock 1.wma | 2019-06-02 11:39 | 489K | |
| Clock 2 (Wake Up).wma | 2019-06-02 11:39 | 524K | |
| Clock 3 (Cadenza).wma | 2019-06-02 11:39 | 297K | |
| Clock 4 (Chirr).wma | 2019-06-02 11:39 | 343K | |
| Clock 5 (Haste).wma | 2019-06-02 11:39 | 635K | |
| Clock 6 (Zenith).wma | 2019-06-02 11:39 | 629K | |
| Clock 7 (Clocksmith).wma | 2019-06-02 11:39 | 384K | |
| Clock 8 (Traditional).wma | 2019-06-02 11:39 | 81K | |
| Clock 9 (Peaceful).wma | 2019-06-02 11:39 | 285K | |
| Clock 10 (Classic).wma | 2019-06-02 11:39 | 227K | |
| Clock 11 (Constellation).wma | 2019-06-02 11:39 | 378K | |
| Clock 12 (Explore).wma | 2019-06-02 11:39 | 262K | |
| Clock 13 (Universe).wma | 2019-06-02 11:39 | 250K | |
| Clock 14 (Timekeeper).wma | 2019-06-02 11:39 | 431K | |
| Clock 15 (Shapes).wma | 2019-06-02 11:39 | 262K | |
| Clock 16 (Radar).wma | 2019-06-02 11:39 | 244K | |
| Clock 17 (Beeper).wma | 2019-06-02 11:39 | 221K | |
| Clock 18 (Brand).wma | 2019-06-02 11:39 | 326K | |
| Clock 19 (Kalimbas).wma | 2019-06-02 11:39 | 629K | |
| Clock 20 (Ensemble).wma | 2019-06-02 11:39 | 454K | |
| Clock 21 (Sensual).wma | 2019-06-02 11:39 | 583K | |
| Clock 22 (Stones).wma | 2019-06-02 11:39 | 489K | |
| Clock 23 (Hang Drum).wma | 2019-06-02 11:39 | 501K | |
| Clock 24 (Space Port).wma | 2019-06-02 11:39 | 507K | |
| Clock 25 (Arcade).wma | 2019-06-02 11:39 | 448K | |
| Clock 26 (Odyssey).wma | 2019-06-02 11:39 | 326K | |
| Clock 27 (Walk).wma | 2019-06-02 11:39 | 419K | |
| Clock 28 (Morning).wma | 2019-06-02 11:39 | 466K | |
| Clock 29 (Pop).wma | 2019-06-02 11:39 | 361K | |
| Clock 30 (Gamelan).wma | 2019-06-02 11:39 | 168K | |
| Clock Cseries.wma | 2019-06-02 11:39 | 262K | |
| Clock Eseries.wma | 2019-06-02 11:39 | 437K | |
| Clock Nseries.wma | 2019-06-02 11:39 | 495K | |
| Clock Xseries.wma | 2019-06-02 11:39 | 390K | |
| Clogged.wma | 2019-06-02 11:39 | 75K | |
| Clouds.wma | 2019-06-02 11:39 | 588K | |
| Clowns.wma | 2019-06-02 11:39 | 197K | |
| Coalesce.wma | 2019-06-02 11:39 | 355K | |
| Coast Drive.wma | 2019-06-02 11:39 | 396K | |
| Coconut.wma | 2019-06-02 11:39 | 343K | |
| Cocoon.wma | 2019-06-02 11:39 | 524K | |
| Coil.wma | 2019-06-02 11:39 | 267K | |
| Coin.wma | 2019-06-02 11:39 | 81K | |
| Collective.wma | 2019-06-02 11:39 | 559K | |
| Color to My World.wma | 2019-06-02 11:39 | 553K | |
| Colosseum.wma | 2019-06-02 11:39 | 536K | |
| Com Voce.wma | 2019-06-02 11:39 | 413K | |
| Come Fill Me In.wma | 2019-06-02 11:39 | 518K | |
| Come and Play.wma | 2019-06-02 11:39 | 320K | |
| Coming Home.wma | 2019-06-02 11:39 | 513K | |
| Computer OK.wma | 2019-06-02 11:39 | 443K | |
| Concertina.wma | 2019-06-02 11:39 | 495K | |
| Concertino.wma | 2019-06-02 11:39 | 583K | |
| Concierge.wma | 2019-06-02 11:39 | 63K | |
| Conjunction.wma | 2019-06-02 11:39 | 273K | |
| Construction.wma | 2019-06-02 11:39 | 396K | |
| Contours.wma | 2019-06-02 11:39 | 583K | |
| Contraflow.wma | 2019-06-02 11:39 | 232K | |
| Copper Sound.wma | 2019-06-02 11:39 | 635K | |
| Coral Reef.wma | 2019-06-02 11:39 | 267K | |
| Core.wma | 2019-06-02 11:39 | 466K | |
| Corporation.wma | 2019-06-02 11:39 | 606K | |
| Cottage.wma | 2019-06-02 11:39 | 367K | |
| Counterflow.wma | 2019-06-02 11:39 | 437K | |
| Countryside.wma | 2019-06-02 11:39 | 332K | |
| Crop Circle.wma | 2019-06-02 11:39 | 232K | |
| Crossroad.wma | 2019-06-02 11:39 | 483K | |
| Crunch.wma | 2019-06-02 11:39 | 606K | |
| Crush.wma | 2019-06-02 11:39 | 437K | |
| Crystal.wma | 2019-06-02 11:39 | 122K | |
| Crystals.wma | 2019-06-02 11:39 | 396K | |
| Cubicle.wma | 2019-06-02 11:39 | 34K | |
| Cuckoo.wma | 2019-06-02 11:39 | 81K | |
| Curl.wma | 2019-06-02 11:39 | 326K | |
| Dance.wma | 2019-06-02 11:39 | 629K | |
| Dance Floor.wma | 2019-06-02 11:39 | 378K | |
| Danceholic.wma | 2019-06-02 11:39 | 361K | |
| Dancers.wma | 2019-06-02 11:39 | 367K | |
| Dancy.wma | 2019-06-02 11:39 | 390K | |
| Dawn.wma | 2019-06-02 11:39 | 588K | |
| Dawning.wma | 2019-06-02 11:39 | 139K | |
| Daytime.wma | 2019-06-02 11:39 | 302K | |
| Deal.wma | 2019-06-02 11:39 | 536K | |
| Debussy.wma | 2019-06-02 11:39 | 448K | |
| Decor.wma | 2019-06-02 11:39 | 589K | |
| Deep Blue Pixel.wma | 2019-06-02 11:39 | 553K | |
| Deep Red Funk.wma | 2019-06-02 11:39 | 402K | |
| Delays.wma | 2019-06-02 11:39 | 162K | |
| Delirium.wma | 2019-06-02 11:39 | 466K | |
| Density.wma | 2019-06-02 11:39 | 291K | |
| Desert Tender.wma | 2019-06-02 11:39 | 489K | |
| Desert Wind.wma | 2019-06-02 11:39 | 536K | |
| Desire.wma | 2019-06-02 11:39 | 577K | |
| Destination.wma | 2019-06-02 11:39 | 431K | |
| Destiny.wma | 2019-06-02 11:39 | 332K | |
| Dewdrop.wma | 2019-06-02 11:39 | 378K | |
| Diazinon.wma | 2019-06-02 11:39 | 478K | |
| Digital.wma | 2019-06-02 11:39 | 75K | |
| Digital Thump.wma | 2019-06-02 11:39 | 501K | |
| Digitize.wma | 2019-06-02 11:39 | 466K | |
| Dim.wma | 2019-06-02 11:39 | 583K | |
| Ding.wma | 2019-06-02 11:39 | 122K | |
| Ding Dong.wma | 2019-06-02 11:39 | 104K | |
| Diplex.wma | 2019-06-02 11:39 | 75K | |
| Disco-Charge.wma | 2019-06-02 11:39 | 495K | |
| Discoid.wma | 2019-06-02 11:39 | 524K | |
| Discovery.wma | 2019-06-02 11:39 | 367K | |
| Do It.wma | 2019-06-02 11:39 | 518K | |
| Dobber.wma | 2019-06-02 11:39 | 565K | |
| Dominator.wma | 2019-06-02 11:39 | 338K | |
| Don't Know.wma | 2019-06-02 11:39 | 629K | |
| Dotted.wma | 2019-06-02 11:39 | 291K | |
| Doughnut.wma | 2019-06-02 11:39 | 221K | |
| Downward.wma | 2019-06-02 11:39 | 483K | |
| Dream of Forever.wma | 2019-06-02 11:39 | 530K | |
| Drill.wma | 2019-06-02 11:39 | 524K | |
| Drip Groove.wma | 2019-06-02 11:39 | 431K | |
| Droplet.wma | 2019-06-02 11:39 | 548K | |
| Dub.wma | 2019-06-02 11:39 | 472K | |
| Dublee.wma | 2019-06-02 11:39 | 559K | |
| Duel.wma | 2019-06-02 11:39 | 273K | |
| Dusk.wma | 2019-06-02 11:39 | 227K | |
| Dynamic.wma | 2019-06-02 11:39 | 157K | |
| Eaglestone.wma | 2019-06-02 11:39 | 513K | |
| Earl's Torch.wma | 2019-06-02 11:39 | 635K | |
| Earthen.wma | 2019-06-02 11:39 | 495K | |
| Eastern Forest.wma | 2019-06-02 11:39 | 262K | |
| Ebb.wma | 2019-06-02 11:39 | 553K | |
| Echo.wma | 2019-06-02 11:39 | 75K | |
| Ecliptic.wma | 2019-06-02 11:39 | 139K | |
| Edges.wma | 2019-06-02 11:39 | 460K | |
| Edgy.wma | 2019-06-02 11:39 | 297K | |
| Elecredible.wma | 2019-06-02 11:39 | 390K | |
| Electra.wma | 2019-06-02 11:39 | 256K | |
| Electric.wma | 2019-06-02 11:39 | 332K | |
| Electric Eel.wma | 2019-06-02 11:39 | 448K | |
| Electric Marimba.wma | 2019-06-02 11:39 | 518K | |
| Electricity.wma | 2019-06-02 11:39 | 431K | |
| Electrode.wma | 2019-06-02 11:39 | 448K | |
| Electronic.wma | 2019-06-02 11:39 | 52K | |
| Elephant.wma | 2019-06-02 11:39 | 629K | |
| Elevator.wma | 2019-06-02 11:39 | 285K | |
| Elgar.wma | 2019-06-02 11:39 | 513K | |
| Elves.wma | 2019-06-02 11:39 | 285K | |
| Emblazon.wma | 2019-06-02 11:39 | 530K | |
| Emerald.wma | 2019-06-02 11:39 | 69K | |
| Emile.wma | 2019-06-02 11:39 | 273K | |
| En Route.wma | 2019-06-02 11:39 | 396K | |
| Endless Flow.wma | 2019-06-02 11:39 | 425K | |
| Eozon.wma | 2019-06-02 11:39 | 583K | |
| Escape.wma | 2019-06-02 11:39 | 635K | |
| Espionage.wma | 2019-06-02 11:39 | 495K | |
| Espresso.wma | 2019-06-02 11:39 | 162K | |
| Eternal.wma | 2019-06-02 11:39 | 513K | |
| Euphoria.wma | 2019-06-02 11:39 | 431K | |
| Euphorium.wma | 2019-06-02 11:39 | 594K | |
| Evening.wma | 2019-06-02 11:39 | 413K | |
| Everlasting.wma | 2019-06-02 11:39 | 332K | |
| Excitement.wma | 2019-06-02 11:39 | 501K | |
| Exhilaration.wma | 2019-06-02 11:39 | 221K | |
| Experiment.wma | 2019-06-02 11:39 | 373K | |
| Extracted.wma | 2019-06-02 11:39 | 553K | |
| Eyelid.wma | 2019-06-02 11:39 | 250K | |
| Fades.wma | 2019-06-02 11:39 | 326K | |
| Falls.wma | 2019-06-02 11:39 | 629K | |
| Fantasy.wma | 2019-06-02 11:39 | 594K | |
| Fast-Flying.wma | 2019-06-02 11:39 | 297K | |
| Fast Track.wma | 2019-06-02 11:39 | 559K | |
| Fat Scratch.wma | 2019-06-02 11:39 | 343K | |
| Feelings.wma | 2019-06-02 11:39 | 554K | |
| Feliciana.wma | 2019-06-02 11:39 | 460K | |
| Festive.wma | 2019-06-02 11:39 | 489K | |
| Fete.wma | 2019-06-02 11:39 | 104K | |
| Fire Plectrum.wma | 2019-06-02 11:39 | 244K | |
| Firefly.wma | 2019-06-02 11:39 | 524K | |
| Fisheye.wma | 2019-06-02 11:39 | 285K | |
| Fitted and Turned.wma | 2019-06-02 11:39 | 518K | |
| Fixate.wma | 2019-06-02 11:39 | 460K | |
| Fizz.wma | 2019-06-02 11:39 | 250K | |
| Flamboy.wma | 2019-06-02 11:39 | 396K | |
| Flash Sparkle.wma | 2019-06-02 11:39 | 419K | |
| Flashes of Brilliance.wma | 2019-06-02 11:39 | 443K | |
| Flat Cats.wma | 2019-06-02 11:39 | 302K | |
| Flattered.wma | 2019-06-02 11:39 | 466K | |
| Flavors.wma | 2019-06-02 11:39 | 186K | |
| Flight.wma | 2019-06-02 11:39 | 110K | |
| Float.wma | 2019-06-02 11:39 | 390K | |
| Floating.wma | 2019-06-02 11:39 | 361K | |
| Flotilla.wma | 2019-06-02 11:39 | 297K | |
| Flow.wma | 2019-06-02 11:39 | 414K | |
| Flummox.wma | 2019-06-02 11:39 | 483K | |
| Flurry.wma | 2019-06-02 11:39 | 104K | |
| Flute Funk.wma | 2019-06-02 11:39 | 548K | |
| Flux.wma | 2019-06-02 11:39 | 553K | |
| Flying.wma | 2019-06-02 11:39 | 373K | |
| Flying Colors.wma | 2019-06-02 11:39 | 618K | |
| Flying Snow.wma | 2019-06-02 11:39 | 571K | |
| Foliage.wma | 2019-06-02 11:39 | 285K | |
| Fondant.wma | 2019-06-02 11:39 | 361K | |
| Forest Lake.wma | 2019-06-02 11:39 | 256K | |
| Fortune-Teller.wma | 2019-06-02 11:39 | 501K | |
| Free Ooze.wma | 2019-06-02 11:39 | 495K | |
| Freeheart.wma | 2019-06-02 11:39 | 343K | |
| Freeze.wma | 2019-06-02 11:39 | 326K | |
| Frenzy.wma | 2019-06-02 11:39 | 332K | |
| Frequency.wma | 2019-06-02 11:39 | 495K | |
| Fried.wma | 2019-06-02 11:39 | 139K | |
| Full.wma | 2019-06-02 11:39 | 507K | |
| Fury.wma | 2019-06-02 11:39 | 419K | |
| Fuse.wma | 2019-06-02 11:39 | 320K | |
| Futurefare.wma | 2019-06-02 11:39 | 600K | |
| Futurism Now.wma | 2019-06-02 11:39 | 629K | |
| Futuristico.wma | 2019-06-02 11:39 | 373K | |
| Garden.wma | 2019-06-02 11:39 | 513K | |
| Geiger.wma | 2019-06-02 11:39 | 63K | |
| Generation.wma | 2019-06-02 11:39 | 553K | |
| Get On Up.wma | 2019-06-02 11:39 | 501K | |
| Glacier.wma | 2019-06-02 11:39 | 355K | |
| Glare.wma | 2019-06-02 11:39 | 355K | |
| Glass.wma | 2019-06-02 11:39 | 110K | |
| Glass Shapes.wma | 2019-06-02 11:39 | 583K | |
| Glassware.wma | 2019-06-02 11:39 | 384K | |
| Glint.wma | 2019-06-02 11:39 | 343K | |
| Glitch.wma | 2019-06-02 11:39 | 524K | |
| Glitter.wma | 2019-06-02 11:39 | 349K | |
| Glow.wma | 2019-06-02 11:39 | 483K | |
| Glume.wma | 2019-06-02 11:39 | 618K | |
| Goan Adventure.wma | 2019-06-02 11:39 | 635K | |
| Goblin.wma | 2019-06-02 11:39 | 151K | |
| Golden.wma | 2019-06-02 11:39 | 390K | |
| Good Times.wma | 2019-06-02 11:39 | 297K | |
| Gossip.wma | 2019-06-02 11:39 | 413K | |
| Gotta Have.wma | 2019-06-02 11:39 | 332K | |
| Gradient.wma | 2019-06-02 11:39 | 612K | |
| Gradual.wma | 2019-06-02 11:39 | 513K | |
| Graffiti.wma | 2019-06-02 11:39 | 472K | |
| Grand Prix.wma | 2019-06-02 11:39 | 75K | |
| Grapefruit.wma | 2019-06-02 11:39 | 63K | |
| Gritty.wma | 2019-06-02 11:39 | 338K | |
| Grounds.wma | 2019-06-02 11:39 | 553K | |
| Halcyon.wma | 2019-06-02 11:39 | 308K | |
| Half Past Twelve.wma | 2019-06-02 11:39 | 495K | |
| Halokinesis.wma | 2019-06-02 11:39 | 536K | |
| Hamada Wa Totoo.wma | 2019-06-02 11:39 | 507K | |
| Happy-Go-Lucky.wma | 2019-06-02 11:39 | 606K | |
| Happy Chord.wma | 2019-06-02 11:39 | 122K | |
| Happy Hipster.wma | 2019-06-02 11:39 | 507K | |
| Happy Hour.wma | 2019-06-02 11:39 | 489K | |
| Harmonic.wma | 2019-06-02 11:39 | 221K | |
| Harptivox.wma | 2019-06-02 11:39 | 279K | |
| Hearts and Minds.wma | 2019-06-02 11:39 | 326K | |
| Heat Wave.wma | 2019-06-02 11:39 | 355K | |
| Heather.wma | 2019-06-02 11:39 | 133K | |
| Heavenly.wma | 2019-06-02 11:39 | 478K | |
| Heels.wma | 2019-06-02 11:39 | 466K | |
| Helical.wma | 2019-06-02 11:39 | 542K | |
| Hello.wma | 2019-06-02 11:39 | 308K | |
| Here.wma | 2019-06-02 11:39 | 174K | |
| High-Speed Rail.wma | 2019-06-02 11:39 | 232K | |
| High Sine.wma | 2019-06-02 11:39 | 75K | |
| Higher.wma | 2019-06-02 11:39 | 425K | |
| Hitchhiker.wma | 2019-06-02 11:39 | 489K | |
| Hometown.wma | 2019-06-02 11:39 | 472K | |
| Hope.wma | 2019-06-02 11:39 | 530K | |
| Horizon.wma | 2019-06-02 11:39 | 606K | |
| House.wma | 2019-06-02 11:39 | 524K | |
| Hummingbird.wma | 2019-06-02 11:39 | 466K | |
| Hunted.wma | 2019-06-02 11:39 | 326K | |
| Hushed.wma | 2019-06-02 11:39 | 384K | |
| Ice-Breaker.wma | 2019-06-02 11:39 | 349K | |
| Ice.wma | 2019-06-02 11:39 | 483K | |
| Ice Tone.wma | 2019-06-02 11:39 | 402K | |
| Idea.wma | 2019-06-02 11:39 | 489K | |
| Idim.wma | 2019-06-02 11:39 | 338K | |
| Illusionist.wma | 2019-06-02 11:39 | 483K | |
| Imperial.wma | 2019-06-02 11:39 | 104K | |
| Incident.wma | 2019-06-02 11:39 | 553K | |
| Incoming.wma | 2019-06-02 11:39 | 145K | |
| India Bamboo.wma | 2019-06-02 11:39 | 483K | |
| India Retro.wma | 2019-06-02 11:39 | 594K | |
| Indian Rhythm.wma | 2019-06-02 11:39 | 507K | |
| Inject.wma | 2019-06-02 11:39 | 600K | |
| Instant Replay.wma | 2019-06-02 11:39 | 501K | |
| Interlude.wma | 2019-06-02 11:39 | 553K | |
| In the Mood.wma | 2019-06-02 11:39 | 454K | |
| Intro.wma | 2019-06-02 11:39 | 116K | |
| Iron.wma | 2019-06-02 11:39 | 320K | |
| Island.wma | 2019-06-02 11:39 | 472K | |
| Jig.wma | 2019-06-02 11:39 | 507K | |
| Jink.wma | 2019-06-02 11:39 | 332K | |
| Journeys.wma | 2019-06-02 11:39 | 378K | |
| Jumping.wma | 2019-06-02 11:39 | 110K | |
| Junction.wma | 2019-06-02 11:39 | 565K | |
| Jungle.wma | 2019-06-02 11:39 | 635K | |
| Jungle Dream.wma | 2019-06-02 11:39 | 559K | |
| Just Ice.wma | 2019-06-02 11:39 | 256K | |
| Just for Kids.wma | 2019-06-02 11:39 | 127K | |
| Kaleidoscope.wma | 2019-06-02 11:39 | 157K | |
| Kalimba.wma | 2019-06-02 11:39 | 81K | |
| Kapuas River.wma | 2019-06-02 11:39 | 507K | |
| Keypumper.wma | 2019-06-02 11:39 | 291K | |
| Keys.wma | 2019-06-02 11:39 | 297K | |
| Khaleeji Groove.wma | 2019-06-02 11:39 | 489K | |
| Kick.wma | 2019-06-02 11:39 | 110K | |
| Kind.wma | 2019-06-02 11:39 | 227K | |
| Kiwi.wma | 2019-06-02 11:39 | 69K | |
| Klavier.wma | 2019-06-02 11:39 | 151K | |
| La Luna.wma | 2019-06-02 11:39 | 443K | |
| Lakeside.wma | 2019-06-02 11:39 | 629K | |
| Landscape.wma | 2019-06-02 11:39 | 238K | |
| Later.wma | 2019-06-02 11:39 | 536K | |
| Latin Daze.wma | 2019-06-02 11:39 | 553K | |
| Latin Pep.wma | 2019-06-02 11:39 | 443K | |
| Latin Quarter.wma | 2019-06-02 11:39 | 623K | |
| Launch.wma | 2019-06-02 11:39 | 483K | |
| Lead.wma | 2019-06-02 11:39 | 314K | |
| Leap.wma | 2019-06-02 11:39 | 104K | |
| Leave It.wma | 2019-06-02 11:39 | 600K | |
| Leaves.wma | 2019-06-02 11:39 | 466K | |
| Leaves on Water.wma | 2019-06-02 11:39 | 606K | |
| Letterbox.wma | 2019-06-02 11:39 | 75K | |
| Licks.wma | 2019-06-02 11:39 | 244K | |
| Lifeform.wma | 2019-06-02 11:39 | 606K | |
| Lift Off.wma | 2019-06-02 11:39 | 326K | |
| Lighthouse.wma | 2019-06-02 11:39 | 507K | |
| Like I Care.wma | 2019-06-02 11:39 | 314K | |
| Lime Tree.wma | 2019-06-02 11:39 | 145K | |
| Liquid.wma | 2019-06-02 11:39 | 536K | |
| Liquify.wma | 2019-06-02 11:39 | 542K | |
| Listen.wma | 2019-06-02 11:39 | 530K | |
| Liszt.wma | 2019-06-02 11:39 | 629K | |
| Little Shoes.wma | 2019-06-02 11:39 | 559K | |
| Living Room.wma | 2019-06-02 11:39 | 571K | |
| Lo-Fi.wma | 2019-06-02 11:39 | 495K | |
| Locomotive.wma | 2019-06-02 11:39 | 110K | |
| Look.wma | 2019-06-02 11:39 | 629K | |
| Looking Glass.wma | 2019-06-02 11:39 | 408K | |
| Lost in Space.wma | 2019-06-02 11:39 | 244K | |
| Lounge.wma | 2019-06-02 11:39 | 373K | |
| Lounging.wma | 2019-06-02 11:39 | 454K | |
| Lover.wma | 2019-06-02 11:39 | 635K | |
| Low.wma | 2019-06-02 11:39 | 93K | |
| Lucid Dreaming.wma | 2019-06-02 11:39 | 536K | |
| Lucky Five.wma | 2019-06-02 11:39 | 343K | |
| Lumina.wma | 2019-06-02 11:39 | 174K | |
| Luminance.wma | 2019-06-02 11:39 | 320K | |
| Luminosity.wma | 2019-06-02 11:39 | 197K | |
| Lure.wma | 2019-06-02 11:39 | 104K | |
| Lush.wma | 2019-06-02 11:39 | 250K | |
| Ma Aleena.wma | 2019-06-02 11:39 | 489K | |
| Machines.wma | 2019-06-02 11:39 | 244K | |
| Macro.wma | 2019-06-02 11:39 | 139K | |
| Magic Australia.wma | 2019-06-02 11:39 | 466K | |
| Magical.wma | 2019-06-02 11:39 | 425K | |
| Magicked.wma | 2019-06-02 11:39 | 338K | |
| Magnetic.wma | 2019-06-02 11:39 | 553K | |
| Magnetic Coupling.wma | 2019-06-02 11:39 | 629K | |
| Magnetism.wma | 2019-06-02 11:39 | 308K | |
| Malfunction.wma | 2019-06-02 11:39 | 623K | |
| Marbles.wma | 2019-06-02 11:39 | 52K | |
| Marina.wma | 2019-06-02 11:39 | 116K | |
| Marionette.wma | 2019-06-02 11:39 | 174K | |
| Marrakech by Night.wma | 2019-06-02 11:39 | 495K | |
| Mars.wma | 2019-06-02 11:39 | 600K | |
| Marseilles.wma | 2019-06-02 11:39 | 466K | |
| Mashie.wma | 2019-06-02 11:39 | 122K | |
| Material.wma | 2019-06-02 11:39 | 565K | |
| Maximize.wma | 2019-06-02 11:39 | 332K | |
| Megapolis.wma | 2019-06-02 11:39 | 238K | |
| Mei Gong River.wma | 2019-06-02 11:39 | 577K | |
| Mekong Butterfly.wma | 2019-06-02 11:39 | 518K | |
| Mellow.wma | 2019-06-02 11:39 | 75K | |
| Memory.wma | 2019-06-02 11:39 | 396K | |
| Mercurial.wma | 2019-06-02 11:39 | 384K | |
| Mercurial Beat.wma | 2019-06-02 11:39 | 629K | |
| Metamorphosis.wma | 2019-06-02 11:39 | 413K | |
| Metro.wma | 2019-06-02 11:39 | 320K | |
| Metropolis.wma | 2019-06-02 11:39 | 565K | |
| Metropolitan.wma | 2019-06-02 11:39 | 553K | |
| Mexican Hat Dance.wma | 2019-06-02 11:39 | 437K | |
| Milieu.wma | 2019-06-02 11:39 | 361K | |
| Mingle.wma | 2019-06-02 11:39 | 267K | |
| Miniature.wma | 2019-06-02 11:39 | 367K | |
| Miniature of Pond.wma | 2019-06-02 11:39 | 448K | |
| Miniature of Troy.wma | 2019-06-02 11:39 | 571K | |
| Minima.wma | 2019-06-02 11:39 | 145K | |
| Minuscular.wma | 2019-06-02 11:39 | 373K | |
| Miracle.wma | 2019-06-02 11:39 | 338K | |
| Mirror Image.wma | 2019-06-02 11:39 | 279K | |
| Misty.wma | 2019-06-02 11:39 | 588K | |
| Moanday.wma | 2019-06-02 11:39 | 361K | |
| Moderate.wma | 2019-06-02 11:39 | 437K | |
| Modulation.wma | 2019-06-02 11:39 | 279K | |
| Momentum.wma | 2019-06-02 11:39 | 530K | |
| Monkey Drum.wma | 2019-06-02 11:39 | 75K | |
| Monocle.wma | 2019-06-02 11:39 | 75K | |
| Morning Light.wma | 2019-06-02 11:39 | 489K | |
| Motorway.wma | 2019-06-02 11:39 | 139K | |
| Mountain Peaks.wma | 2019-06-02 11:39 | 577K | |
| Mountaineer.wma | 2019-06-02 11:39 | 489K | |
| Mouth.wma | 2019-06-02 11:39 | 542K | |
| Movin'.wma | 2019-06-02 11:39 | 518K | |
| Myriads of Stars.wma | 2019-06-02 11:39 | 361K | |
| Mystic.wma | 2019-06-02 11:39 | 483K | |
| Mystique.wma | 2019-06-02 11:39 | 361K | |
| Nails.wma | 2019-06-02 11:39 | 273K | |
| Nana.wma | 2019-06-02 11:39 | 472K | |
| Nanomal.wma | 2019-06-02 11:39 | 396K | |
| Nasal.wma | 2019-06-02 11:39 | 548K | |
| Nature.wma | 2019-06-02 11:39 | 419K | |
| Need You.wma | 2019-06-02 11:39 | 396K | |
| Neon Smile.wma | 2019-06-02 11:39 | 629K | |
| Neuron Pulse.wma | 2019-06-02 11:39 | 559K | |
| Nick of Time.wma | 2019-06-02 11:39 | 104K | |
| Night Hype.wma | 2019-06-02 11:39 | 612K | |
| Night Shimmer.wma | 2019-06-02 11:39 | 425K | |
| Nightclub.wma | 2019-06-02 11:39 | 594K | |
| Nineties.wma | 2019-06-02 11:39 | 513K | |
| Nocturnal.wma | 2019-06-02 11:39 | 419K | |
| Nocturne.wma | 2019-06-02 11:39 | 367K | |
| Nodular.wma | 2019-06-02 11:39 | 332K | |
| Nokia Cappella.wma | 2019-06-02 11:39 | 308K | |
| Nokia Hybrid Guitar.wma | 2019-06-02 11:39 | 267K | |
| Nokia Music Box.wma | 2019-06-02 11:39 | 232K | |
| Nokia New Generation.wma | 2019-06-02 11:39 | 425K | |
| Nokia Progressive.wma | 2019-06-02 11:39 | 215K | |
| Nokia Pure Redux.wma | 2019-06-02 11:39 | 232K | |
| Nokia Tune (1994).wma | 2019-06-02 11:39 | 81K | |
| Nokia Tune (2002).wma | 2019-06-02 11:39 | 104K | |
| Nokia Tune (2004).wma | 2019-06-02 11:39 | 110K | |
| Nokia Tune (2008).wma | 2019-06-02 11:39 | 612K | |
| Nokia Tune (2011).wma | 2019-06-02 11:39 | 320K | |
| Nokia Tune.wma | 2019-06-02 11:39 | 227K | |
| Nokia Tune Remix.wma | 2019-06-02 11:39 | 396K | |
| Nokiorchestra.wma | 2019-06-02 11:39 | 221K | |
| Nokya in the Sky.wma | 2019-06-02 11:39 | 495K | |
| Nonetheless.wma | 2019-06-02 11:39 | 606K | |
| Nostalgia.wma | 2019-06-02 11:39 | 104K | |
| Note.wma | 2019-06-02 11:39 | 600K | |
| Nouveau Rock.wma | 2019-06-02 11:39 | 577K | |
| Nova.wma | 2019-06-02 11:39 | 361K | |
| Nuance.wma | 2019-06-02 11:39 | 349K | |
| Numeric.wma | 2019-06-02 11:39 | 297K | |
| O Sol.wma | 2019-06-02 11:39 | 448K | |
| Oceanic.wma | 2019-06-02 11:39 | 378K | |
| Octaneum.wma | 2019-06-02 11:39 | 466K | |
| Octopus.wma | 2019-06-02 11:39 | 396K | |
| Old Times.wma | 2019-06-02 11:39 | 419K | |
| On My Own.wma | 2019-06-02 11:39 | 478K | |
| Opal.wma | 2019-06-02 11:39 | 75K | |
| Open.wma | 2019-06-02 11:39 | 378K | |
| Openings.wma | 2019-06-02 11:39 | 308K | |
| Optimus.wma | 2019-06-02 11:39 | 489K | |
| Orb.wma | 2019-06-02 11:39 | 390K | |
| Orchid.wma | 2019-06-02 11:39 | 536K | |
| Oriental.wma | 2019-06-02 11:39 | 518K | |
| Oriental Dreams.wma | 2019-06-02 11:39 | 489K | |
| Origin Mridangam.wma | 2019-06-02 11:39 | 518K | |
| Oscillation.wma | 2019-06-02 11:39 | 69K | |
| Our Day.wma | 2019-06-02 11:39 | 553K | |
| Outburst.wma | 2019-06-02 11:39 | 507K | |
| Outer space.wma | 2019-06-02 11:39 | 302K | |
| Outplay.wma | 2019-06-02 11:39 | 478K | |
| Overdrive.wma | 2019-06-02 11:39 | 507K | |
| Pacific Song.wma | 2019-06-02 11:39 | 501K | |
| Paragon.wma | 2019-06-02 11:39 | 373K | |
| Passe-Partout.wma | 2019-06-02 11:39 | 536K | |
| Past Times.wma | 2019-06-02 11:39 | 513K | |
| Pasta.wma | 2019-06-02 11:39 | 507K | |
| Pastures.wma | 2019-06-02 11:39 | 297K | |
| Paw.wma | 2019-06-02 11:39 | 594K | |
| Peal.wma | 2019-06-02 11:39 | 98K | |
| Pearl.wma | 2019-06-02 11:39 | 197K | |
| Pebble.wma | 2019-06-02 11:39 | 390K | |
| Pedal.wma | 2019-06-02 11:39 | 600K | |
| Pepper.wma | 2019-06-02 11:39 | 250K | |
| Perception.wma | 2019-06-02 11:39 | 588K | |
| Perch.wma | 2019-06-02 11:39 | 338K | |
| Peridot.wma | 2019-06-02 11:39 | 69K | |
| Pick It Up.wma | 2019-06-02 11:39 | 454K | |
| Pick Up the Phone.wma | 2019-06-02 11:39 | 495K | |
| Pinball.wma | 2019-06-02 11:39 | 116K | |
| Pineapple Dance.wma | 2019-06-02 11:39 | 162K | |
| Pitch Bubbles.wma | 2019-06-02 11:39 | 308K | |
| Pixel.wma | 2019-06-02 11:39 | 396K | |
| Placebo.wma | 2019-06-02 11:39 | 338K | |
| Plasma.wma | 2019-06-02 11:39 | 513K | |
| Plastic.wma | 2019-06-02 11:39 | 448K | |
| Platform Rebel.wma | 2019-06-02 11:39 | 629K | |
| Playing Tricks.wma | 2019-06-02 11:39 | 192K | |
| Pliable.wma | 2019-06-02 11:39 | 600K | |
| Plim.wma | 2019-06-02 11:39 | 559K | |
| Plinky Kalinka.wma | 2019-06-02 11:39 | 571K | |
| Ploptic.wma | 2019-06-02 11:39 | 454K | |
| Plur.wma | 2019-06-02 11:39 | 553K | |
| Polar Light.wma | 2019-06-02 11:39 | 267K | |
| Polaris.wma | 2019-06-02 11:39 | 87K | |
| Pong Pong.wma | 2019-06-02 11:39 | 87K | |
| Pool.wma | 2019-06-02 11:39 | 75K | |
| Poolside.wma | 2019-06-02 11:39 | 367K | |
| Pose.wma | 2019-06-02 11:39 | 419K | |
| Positron.wma | 2019-06-02 11:39 | 472K | |
| Present.wma | 2019-06-02 11:39 | 629K | |
| Pretty.wma | 2019-06-02 11:39 | 647K | |
| Princess.wma | 2019-06-02 11:39 | 75K | |
| Prism.wma | 2019-06-02 11:39 | 343K | |
| Progression.wma | 2019-06-02 11:39 | 232K | |
| Progressive.wma | 2019-06-02 11:39 | 507K | |
| Project.wma | 2019-06-02 11:39 | 390K | |
| Prowl.wma | 2019-06-02 11:39 | 168K | |
| Proximity.wma | 2019-06-02 11:39 | 583K | |
| Punch.wma | 2019-06-02 11:39 | 343K | |
| Punjabi.wma | 2019-06-02 11:39 | 583K | |
| Pure.wma | 2019-06-02 11:39 | 338K | |
| Purple.wma | 2019-06-02 11:39 | 157K | |
| Purplex.wma | 2019-06-02 11:39 | 396K | |
| Pursue.wma | 2019-06-02 11:39 | 524K | |
| Quadratic.wma | 2019-06-02 11:39 | 157K | |
| Quartz.wma | 2019-06-02 11:39 | 396K | |
| R'n B.wma | 2019-06-02 11:39 | 629K | |
| Radar.wma | 2019-06-02 11:39 | 81K | |
| Radial.wma | 2019-06-02 11:39 | 256K | |
| Radiant.wma | 2019-06-02 11:39 | 571K | |
| Rai Fusion.wma | 2019-06-02 11:39 | 501K | |
| Rain Shower.wma | 2019-06-02 11:39 | 320K | |
| Raindrops.wma | 2019-06-02 11:39 | 221K | |
| Randomline.wma | 2019-06-02 11:39 | 565K | |
| Rapid.wma | 2019-06-02 11:39 | 116K | |
| Rattle.wma | 2019-06-02 11:39 | 110K | |
| Re-Groove.wma | 2019-06-02 11:39 | 233K | |
| Re-Rumble.wma | 2019-06-02 11:39 | 262K | |
| Reactive.wma | 2019-06-02 11:39 | 384K | |
| Reed.wma | 2019-06-02 11:39 | 87K | |
| Reflection.wma | 2019-06-02 11:39 | 530K | |
| Repetition.wma | 2019-06-02 11:39 | 565K | |
| Reptilian.wma | 2019-06-02 11:39 | 524K | |
| Resonant Bliss.wma | 2019-06-02 11:39 | 483K | |
| Resonate.wma | 2019-06-02 11:39 | 472K | |
| Resonator.wma | 2019-06-02 11:39 | 530K | |
| Rest.wma | 2019-06-02 11:39 | 197K | |
| Retrace.wma | 2019-06-02 11:39 | 507K | |
| Retro.wma | 2019-06-02 11:39 | 232K | |
| Retro Robots.wma | 2019-06-02 11:39 | 548K | |
| Retrobot.wma | 2019-06-02 11:39 | 203K | |
| Retropolis.wma | 2019-06-02 11:39 | 378K | |
| Retroverse.wma | 2019-06-02 11:39 | 338K | |
| Return My Call.wma | 2019-06-02 11:39 | 518K | |
| Reversal.wma | 2019-06-02 11:39 | 571K | |
| Rhodium.wma | 2019-06-02 11:39 | 501K | |
| Rhymer.wma | 2019-06-02 11:39 | 501K | |
| Rice.wma | 2019-06-02 11:39 | 600K | |
| Rides.wma | 2019-06-02 11:39 | 98K | |
| Riff-a-Ring.wma | 2019-06-02 11:39 | 565K | |
| Right This Moment.wma | 2019-06-02 11:39 | 308K | |
| Ring Ring.wma | 2019-06-02 11:39 | 75K | |
| Ringabout.wma | 2019-06-02 11:39 | 396K | |
| Ringing.wma | 2019-06-02 11:39 | 98K | |
| Ringmod.wma | 2019-06-02 11:39 | 396K | |
| Ripple.wma | 2019-06-02 11:39 | 262K | |
| Rise Up.wma | 2019-06-02 11:39 | 583K | |
| Rising.wma | 2019-06-02 11:39 | 396K | |
| Roadie.wma | 2019-06-02 11:39 | 635K | |
| Robo IO.wma | 2019-06-02 11:39 | 139K | |
| Robot.wma | 2019-06-02 11:39 | 408K | |
| Robotique.wma | 2019-06-02 11:39 | 507K | |
| Rock.wma | 2019-06-02 11:39 | 431K | |
| Rock Scissors.wma | 2019-06-02 11:39 | 215K | |
| Rocking India.wma | 2019-06-02 11:39 | 606K | |
| Rooster.wma | 2019-06-02 11:39 | 87K | |
| Rosewood.wma | 2019-06-02 11:39 | 460K | |
| Rotation.wma | 2019-06-02 11:39 | 460K | |
| Roundabout.wma | 2019-06-02 11:39 | 489K | |
| Rove.wma | 2019-06-02 11:39 | 524K | |
| Ruby.wma | 2019-06-02 11:39 | 93K | |
| Run Before You Walk.wma | 2019-06-02 11:39 | 635K | |
| Runs.wma | 2019-06-02 11:39 | 133K | |
| Runway.wma | 2019-06-02 11:39 | 308K | |
| Safari.wma | 2019-06-02 11:39 | 448K | |
| Sand Golem.wma | 2019-06-02 11:39 | 162K | |
| Sandy Dune.wma | 2019-06-02 11:39 | 612K | |
| Sanicle.wma | 2019-06-02 11:39 | 338K | |
| Santoor Fusion.wma | 2019-06-02 11:39 | 431K | |
| Sapphire.wma | 2019-06-02 11:39 | 197K | |
| Sashay.wma | 2019-06-02 11:39 | 443K | |
| Satisfied.wma | 2019-06-02 11:39 | 559K | |
| Saturn.wma | 2019-06-02 11:39 | 513K | |
| Scalier.wma | 2019-06-02 11:39 | 577K | |
| Scatter.wma | 2019-06-02 11:39 | 110K | |
| Schubert.wma | 2019-06-02 11:39 | 314K | |
| Scooped.wma | 2019-06-02 11:39 | 326K | |
| Scratchy.wma | 2019-06-02 11:39 | 577K | |
| Seahorse.wma | 2019-06-02 11:39 | 256K | |
| Seamless.wma | 2019-06-02 11:39 | 250K | |
| Seascapes at Noon.wma | 2019-06-02 11:39 | 629K | |
| Season's Greetings.wma | 2019-06-02 11:39 | 542K | |
| Seduction.wma | 2019-06-02 11:39 | 419K | |
| Selekt.wma | 2019-06-02 11:39 | 507K | |
| Sensation.wma | 2019-06-02 11:39 | 349K | |
| Sensual.wma | 2019-06-02 11:39 | 588K | |
| Serene.wma | 2019-06-02 11:39 | 513K | |
| Serenity.wma | 2019-06-02 11:39 | 629K | |
| Shades.wma | 2019-06-02 11:39 | 267K | |
| Shadow.wma | 2019-06-02 11:39 | 635K | |
| Sharqi 1.wma | 2019-06-02 11:39 | 472K | |
| Sharqi 2.wma | 2019-06-02 11:39 | 466K | |
| Shibata.wma | 2019-06-02 11:39 | 530K | |
| Shimmer.wma | 2019-06-02 11:39 | 320K | |
| Shimmering.wma | 2019-06-02 11:39 | 378K | |
| Shimmy.wma | 2019-06-02 11:39 | 332K | |
| Shine.wma | 2019-06-02 11:39 | 104K | |
| Shining.wma | 2019-06-02 11:39 | 507K | |
| Shout.wma | 2019-06-02 11:39 | 466K | |
| Shuffle Step.wma | 2019-06-02 11:39 | 489K | |
| Shuttle.wma | 2019-06-02 11:39 | 373K | |
| Signal.wma | 2019-06-02 11:39 | 87K | |
| Signum.wma | 2019-06-02 11:39 | 75K | |
| Silhouette.wma | 2019-06-02 11:39 | 308K | |
| Silk.wma | 2019-06-02 11:39 | 174K | |
| Silkscreen.wma | 2019-06-02 11:39 | 571K | |
| Silvan Pond.wma | 2019-06-02 11:39 | 285K | |
| Silver (Original).wma | 2019-06-02 11:39 | 425K | |
| Silver.wma | 2019-06-02 11:39 | 408K | |
| Silvery Bright.wma | 2019-06-02 11:39 | 443K | |
| Simply African.wma | 2019-06-02 11:39 | 454K | |
| Sinesong.wma | 2019-06-02 11:39 | 256K | |
| Sing.wma | 2019-06-02 11:39 | 629K | |
| Sizzle Brazil.wma | 2019-06-02 11:39 | 536K | |
| Sizzlin'.wma | 2019-06-02 11:39 | 571K | |
| Skate.wma | 2019-06-02 11:39 | 443K | |
| Skittle.wma | 2019-06-02 11:39 | 332K | |
| Sky-Blue Blimp.wma | 2019-06-02 11:39 | 203K | |
| Sky-High.wma | 2019-06-02 11:39 | 215K | |
| Skysail.wma | 2019-06-02 11:39 | 448K | |
| Skyward.wma | 2019-06-02 11:39 | 419K | |
| Slap On.wma | 2019-06-02 11:39 | 483K | |
| Slapstick.wma | 2019-06-02 11:39 | 501K | |
| Slow Coffee.wma | 2019-06-02 11:39 | 425K | |
| Smile.wma | 2019-06-02 11:39 | 501K | |
| Smoky Eyes.wma | 2019-06-02 11:39 | 437K | |
| Snake Bite.wma | 2019-06-02 11:39 | 378K | |
| Snapdragon.wma | 2019-06-02 11:39 | 297K | |
| Snow.wma | 2019-06-02 11:39 | 338K | |
| Snowfight.wma | 2019-06-02 11:39 | 367K | |
| Snowl.wma | 2019-06-02 11:39 | 203K | |
| Soda Pop.wma | 2019-06-02 11:39 | 297K | |
| Solar.wma | 2019-06-02 11:39 | 583K | |
| Solar Eclipse.wma | 2019-06-02 11:39 | 302K | |
| Solenoid.wma | 2019-06-02 11:39 | 507K | |
| Solution.wma | 2019-06-02 11:39 | 472K | |
| Sonar.wma | 2019-06-02 11:39 | 378K | |
| Sooth.wma | 2019-06-02 11:39 | 530K | |
| Sordino.wma | 2019-06-02 11:39 | 75K | |
| Soul.wma | 2019-06-02 11:39 | 548K | |
| Soulful.wma | 2019-06-02 11:39 | 443K | |
| Space Shield.wma | 2019-06-02 11:39 | 110K | |
| Spacial.wma | 2019-06-02 11:39 | 524K | |
| Sparkledust.wma | 2019-06-02 11:39 | 495K | |
| Sparkles.wma | 2019-06-02 11:39 | 355K | |
| Specialist.wma | 2019-06-02 11:39 | 349K | |
| Spell.wma | 2019-06-02 11:39 | 355K | |
| Sphere.wma | 2019-06-02 11:39 | 583K | |
| Spirit of India.wma | 2019-06-02 11:39 | 518K | |
| Spring Field.wma | 2019-06-02 11:39 | 332K | |
| Spring Toy.wma | 2019-06-02 11:39 | 122K | |
| Springlike.wma | 2019-06-02 11:39 | 396K | |
| Springtime.wma | 2019-06-02 11:39 | 244K | |
| Sprinkle.wma | 2019-06-02 11:39 | 507K | |
| Stack.wma | 2019-06-02 11:39 | 110K | |
| Stadium.wma | 2019-06-02 11:39 | 419K | |
| Staggered.wma | 2019-06-02 11:39 | 203K | |
| Stars.wma | 2019-06-02 11:39 | 536K | |
| Starsign.wma | 2019-06-02 11:39 | 413K | |
| Startup.wma | 2019-06-02 11:39 | 454K | |
| Stay That Way.wma | 2019-06-02 11:39 | 524K | |
| Steely.wma | 2019-06-02 11:39 | 291K | |
| Stellar Light.wma | 2019-06-02 11:39 | 536K | |
| Steppre.wma | 2019-06-02 11:39 | 629K | |
| Stinger.wma | 2019-06-02 11:39 | 518K | |
| Straightway.wma | 2019-06-02 11:39 | 437K | |
| Streetwise.wma | 2019-06-02 11:39 | 495K | |
| Strike One.wma | 2019-06-02 11:39 | 577K | |
| Sub-Zero.wma | 2019-06-02 11:39 | 571K | |
| Subhop.wma | 2019-06-02 11:39 | 530K | |
| Sublunar.wma | 2019-06-02 11:39 | 390K | |
| Subtile.wma | 2019-06-02 11:39 | 180K | |
| Sumatra Ring.wma | 2019-06-02 11:39 | 343K | |
| Summer Beats.wma | 2019-06-02 11:39 | 518K | |
| Summer Fruit.wma | 2019-06-02 11:39 | 390K | |
| Summer Jam.wma | 2019-06-02 11:39 | 548K | |
| Summer Rain.wma | 2019-06-02 11:39 | 495K | |
| Sun Fun.wma | 2019-06-02 11:39 | 472K | |
| Sunday Walk.wma | 2019-06-02 11:39 | 513K | |
| Sundown.wma | 2019-06-02 11:39 | 542K | |
| Sunny Day.wma | 2019-06-02 11:39 | 367K | |
| Sunset.wma | 2019-06-02 11:39 | 542K | |
| Superior.wma | 2019-06-02 11:39 | 588K | |
| Surface.wma | 2019-06-02 11:39 | 297K | |
| Sweet Jamming.wma | 2019-06-02 11:39 | 378K | |
| Sweet Voice.wma | 2019-06-02 11:39 | 466K | |
| Sweetie.wma | 2019-06-02 11:39 | 472K | |
| Sweets.wma | 2019-06-02 11:39 | 92K | |
| Swimming.wma | 2019-06-02 11:39 | 373K | |
| Swing By.wma | 2019-06-02 11:39 | 507K | |
| Swipper.wma | 2019-06-02 11:39 | 390K | |
| Swish.wma | 2019-06-02 11:39 | 314K | |
| Synaptic Jolt.wma | 2019-06-02 11:39 | 367K | |
| Synloop.wma | 2019-06-02 11:39 | 151K | |
| Synthesizer.wma | 2019-06-02 11:39 | 437K | |
| Tablet.wma | 2019-06-02 11:39 | 559K | |
| Take Away Blues.wma | 2019-06-02 11:39 | 495K | |
| Tango Dally.wma | 2019-06-02 11:39 | 513K | |
| Tap Circle.wma | 2019-06-02 11:39 | 448K | |
| Tap Dance.wma | 2019-06-02 11:39 | 174K | |
| Tarmac.wma | 2019-06-02 11:39 | 623K | |
| Telegraph.wma | 2019-06-02 11:39 | 75K | |
| Telescope.wma | 2019-06-02 11:39 | 326K | |
| Temporal.wma | 2019-06-02 11:39 | 489K | |
| Tender.wma | 2019-06-02 11:39 | 349K | |
| Terrestrial.wma | 2019-06-02 11:39 | 483K | |
| The Aristocrat.wma | 2019-06-02 11:39 | 524K | |
| The Big Dragon.wma | 2019-06-02 11:39 | 390K | |
| The Peony Pavilion.wma | 2019-06-02 11:39 | 472K | |
| The Trick.wma | 2019-06-02 11:39 | 320K | |
| Thistle.wma | 2019-06-02 11:39 | 209K | |
| Thrilling.wma | 2019-06-02 11:39 | 542K | |
| Tick.wma | 2019-06-02 11:39 | 285K | |
| Tickle.wma | 2019-06-02 11:39 | 448K | |
| Tides.wma | 2019-06-02 11:39 | 443K | |
| Tiger Eye.wma | 2019-06-02 11:39 | 87K | |
| Timeless.wma | 2019-06-02 11:39 | 448K | |
| Timer.wma | 2019-06-02 11:39 | 122K | |
| Timid.wma | 2019-06-02 11:39 | 314K | |
| Tin Can.wma | 2019-06-02 11:39 | 215K | |
| Tinker.wma | 2019-06-02 11:39 | 98K | |
| Tinkly.wma | 2019-06-02 11:39 | 244K | |
| Tiptoe.wma | 2019-06-02 11:39 | 548K | |
| Titanics.wma | 2019-06-02 11:39 | 168K | |
| Today.wma | 2019-06-02 11:39 | 612K | |
| Together.wma | 2019-06-02 11:39 | 583K | |
| Too Hot.wma | 2019-06-02 11:39 | 273K | |
| Topic.wma | 2019-06-02 11:39 | 75K | |
| Tourmaline.wma | 2019-06-02 11:39 | 81K | |
| Toys.wma | 2019-06-02 11:39 | 250K | |
| Trade.wma | 2019-06-02 11:39 | 238K | |
| Trails.wma | 2019-06-02 11:39 | 209K | |
| Trance.wma | 2019-06-02 11:39 | 460K | |
| Transcend.wma | 2019-06-02 11:39 | 478K | |
| Translucent.wma | 2019-06-02 11:39 | 507K | |
| Tranzform.wma | 2019-06-02 11:39 | 501K | |
| Trapeze.wma | 2019-06-02 11:39 | 635K | |
| Travels.wma | 2019-06-02 11:39 | 443K | |
| Traversal.wma | 2019-06-02 11:39 | 489K | |
| Triangle.wma | 2019-06-02 11:39 | 507K | |
| Tribal.wma | 2019-06-02 11:39 | 413K | |
| Tricycle.wma | 2019-06-02 11:39 | 92K | |
| Trike.wma | 2019-06-02 11:39 | 513K | |
| Trill.wma | 2019-06-02 11:39 | 297K | |
| Trio.wma | 2019-06-02 11:39 | 81K | |
| Trip Hop.wma | 2019-06-02 11:39 | 501K | |
| Triple Rainbow.wma | 2019-06-02 11:39 | 361K | |
| Tronic.wma | 2019-06-02 11:39 | 513K | |
| Tropic.wma | 2019-06-02 11:39 | 203K | |
| Tropical.wma | 2019-06-02 11:39 | 448K | |
| Tropicasia.wma | 2019-06-02 11:39 | 443K | |
| Trout.wma | 2019-06-02 11:39 | 472K | |
| Tumble to the Stars.wma | 2019-06-02 11:39 | 542K | |
| Turbine.wma | 2019-06-02 11:39 | 501K | |
| Turquoise.wma | 2019-06-02 11:39 | 110K | |
| Twang.wma | 2019-06-02 11:39 | 507K | |
| Tweet Twoo.wma | 2019-06-02 11:39 | 571K | |
| Twinkle.wma | 2019-06-02 11:39 | 448K | |
| Twitter.wma | 2019-06-02 11:39 | 92K | |
| Unia.wma | 2019-06-02 11:39 | 495K | |
| Unicorn.wma | 2019-06-02 11:39 | 565K | |
| United.wma | 2019-06-02 11:39 | 355K | |
| Univere.wma | 2019-06-02 11:39 | 425K | |
| Unseen.wma | 2019-06-02 11:39 | 524K | |
| Urgent.wma | 2019-06-02 11:39 | 81K | |
| Valiant.wma | 2019-06-02 11:39 | 629K | |
| Valley.wma | 2019-06-02 11:39 | 402K | |
| Valve.wma | 2019-06-02 11:39 | 390K | |
| Vanilla.wma | 2019-06-02 11:39 | 623K | |
| Vent.wma | 2019-06-02 11:39 | 116K | |
| Venture.wma | 2019-06-02 11:39 | 507K | |
| Venue.wma | 2019-06-02 11:39 | 623K | |
| Vertex.wma | 2019-06-02 11:39 | 133K | |
| Vibe.wma | 2019-06-02 11:39 | 256K | |
| Victory.wma | 2019-06-02 11:39 | 478K | |
| Vinyl.wma | 2019-06-02 11:39 | 396K | |
| Vinyl Style.wma | 2019-06-02 11:39 | 349K | |
| Violet.wma | 2019-06-02 11:39 | 419K | |
| Vivid Matt.wma | 2019-06-02 11:39 | 355K | |
| Voices.wma | 2019-06-02 11:39 | 425K | |
| Vortex.wma | 2019-06-02 11:39 | 273K | |
| Voyage.wma | 2019-06-02 11:39 | 267K | |
| Wah Wah.wma | 2019-06-02 11:39 | 355K | |
| Waiting.wma | 2019-06-02 11:39 | 443K | |
| Walk Away.wma | 2019-06-02 11:39 | 302K | |
| Walking.wma | 2019-06-02 11:39 | 355K | |
| Walking On.wma | 2019-06-02 11:39 | 501K | |
| Walk in the Park.wma | 2019-06-02 11:39 | 338K | |
| Warm.wma | 2019-06-02 11:39 | 267K | |
| Warm at Heart.wma | 2019-06-02 11:39 | 454K | |
| Warped.wma | 2019-06-02 11:39 | 396K | |
| Wasp.wma | 2019-06-02 11:39 | 157K | |
| Water Ring.wma | 2019-06-02 11:39 | 279K | |
| Waterways.wma | 2019-06-02 11:39 | 314K | |
| Weave.wma | 2019-06-02 11:39 | 419K | |
| Welcome.wma | 2019-06-02 11:39 | 623K | |
| Westward.wma | 2019-06-02 11:39 | 495K | |
| Whales.wma | 2019-06-02 11:39 | 501K | |
| What's Up.wma | 2019-06-02 11:39 | 268K | |
| Wheels.wma | 2019-06-02 11:39 | 273K | |
| Whistling.wma | 2019-06-02 11:39 | 209K | |
| Whoop.wma | 2019-06-02 11:39 | 454K | |
| Wigs.wma | 2019-06-02 11:39 | 530K | |
| Wind Dance.wma | 2019-06-02 11:39 | 594K | |
| Wind Passion.wma | 2019-06-02 11:39 | 588K | |
| Windbreak.wma | 2019-06-02 11:39 | 378K | |
| Windswept.wma | 2019-06-02 11:39 | 472K | |
| Wired Up.wma | 2019-06-02 11:39 | 332K | |
| Wisp.wma | 2019-06-02 11:39 | 326K | |
| Wiz Bang.wma | 2019-06-02 11:39 | 326K | |
| Wobbles.wma | 2019-06-02 11:39 | 606K | |
| Wolfgang.wma | 2019-06-02 11:39 | 332K | |
| Wondercall.wma | 2019-06-02 11:39 | 425K | |
| Wood Bell.wma | 2019-06-02 11:39 | 110K | |
| Woodblock.wma | 2019-06-02 11:39 | 81K | |
| Woods.wma | 2019-06-02 11:39 | 343K | |
| Woodsman.wma | 2019-06-02 11:39 | 548K | |
| Words.wma | 2019-06-02 11:39 | 629K | |
| Worldly.wma | 2019-06-02 11:39 | 501K | |
| Worm.wma | 2019-06-02 11:39 | 448K | |
| Xylophone.wma | 2019-06-02 11:39 | 92K | |
| Xylotron.wma | 2019-06-02 11:39 | 618K | |
| Yearn.wma | 2019-06-02 11:39 | 513K | |
| Yearning.wma | 2019-06-02 11:39 | 518K | |
| Yellowish.wma | 2019-06-02 11:39 | 192K | |
| You're Walking.wma | 2019-06-02 11:39 | 530K | |
| Zanjebar.wma | 2019-06-02 11:39 | 489K | |
| Zee Beam.wma | 2019-06-02 11:39 | 419K | |
| Zen.wma | 2019-06-02 11:39 | 273K | |