![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | Bureau.wma | 2019-06-02 11:39 | 34K | |
![[SND]](/icons/sound2.gif) | Cubicle.wma | 2019-06-02 11:39 | 34K | |
![[SND]](/icons/sound2.gif) | Calendar 1.wma | 2019-06-02 11:39 | 52K | |
![[SND]](/icons/sound2.gif) | Electronic.wma | 2019-06-02 11:39 | 52K | |
![[SND]](/icons/sound2.gif) | Marbles.wma | 2019-06-02 11:39 | 52K | |
![[SND]](/icons/sound2.gif) | Amethyst.wma | 2019-06-02 11:39 | 57K | |
![[SND]](/icons/sound2.gif) | Cackle.wma | 2019-06-02 11:39 | 58K | |
![[SND]](/icons/sound2.gif) | Applebite.wma | 2019-06-02 11:39 | 63K | |
![[SND]](/icons/sound2.gif) | Beep.wma | 2019-06-02 11:39 | 63K | |
![[SND]](/icons/sound2.gif) | Calendar 2.wma | 2019-06-02 11:39 | 63K | |
![[SND]](/icons/sound2.gif) | Calendar 4.wma | 2019-06-02 11:39 | 63K | |
![[SND]](/icons/sound2.gif) | Concierge.wma | 2019-06-02 11:39 | 63K | |
![[SND]](/icons/sound2.gif) | Grapefruit.wma | 2019-06-02 11:39 | 63K | |
![[SND]](/icons/sound2.gif) | Geiger.wma | 2019-06-02 11:39 | 63K | |
![[SND]](/icons/sound2.gif) | Amazement.wma | 2019-06-02 11:39 | 69K | |
![[SND]](/icons/sound2.gif) | Bird.wma | 2019-06-02 11:39 | 69K | |
![[SND]](/icons/sound2.gif) | Buzzer.wma | 2019-06-02 11:39 | 69K | |
![[SND]](/icons/sound2.gif) | Calendar 3.wma | 2019-06-02 11:39 | 69K | |
![[SND]](/icons/sound2.gif) | Emerald.wma | 2019-06-02 11:39 | 69K | |
![[SND]](/icons/sound2.gif) | Kiwi.wma | 2019-06-02 11:39 | 69K | |
![[SND]](/icons/sound2.gif) | Peridot.wma | 2019-06-02 11:39 | 69K | |
![[SND]](/icons/sound2.gif) | Oscillation.wma | 2019-06-02 11:39 | 69K | |
![[SND]](/icons/sound2.gif) | Candy.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Clogged.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Digital.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Diplex.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Echo.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | High Sine.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Letterbox.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Mellow.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Monkey Drum.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Monocle.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Pool.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Princess.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Signum.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Sordino.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Telegraph.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Topic.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Cab.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Grand Prix.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Opal.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Ring Ring.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Clerk.wma | 2019-06-02 11:39 | 75K | |
![[SND]](/icons/sound2.gif) | Bullfrog.wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Clari.wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Click.wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Coin.wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Cuckoo.wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Kalimba.wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Nokia Tune (1994).wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Radar.wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Tourmaline.wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Trio.wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Urgent.wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Woodblock.wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Clock 8 (Traditional).wma | 2019-06-02 11:39 | 81K | |
![[SND]](/icons/sound2.gif) | Broken Tone.wma | 2019-06-02 11:39 | 87K | |
![[SND]](/icons/sound2.gif) | Polaris.wma | 2019-06-02 11:39 | 87K | |
![[SND]](/icons/sound2.gif) | Reed.wma | 2019-06-02 11:39 | 87K | |
![[SND]](/icons/sound2.gif) | Rooster.wma | 2019-06-02 11:39 | 87K | |
![[SND]](/icons/sound2.gif) | Signal.wma | 2019-06-02 11:39 | 87K | |
![[SND]](/icons/sound2.gif) | Tiger Eye.wma | 2019-06-02 11:39 | 87K | |
![[SND]](/icons/sound2.gif) | Cassiterite.wma | 2019-06-02 11:39 | 87K | |
![[SND]](/icons/sound2.gif) | Pong Pong.wma | 2019-06-02 11:39 | 87K | |
![[SND]](/icons/sound2.gif) | Calendar 5.wma | 2019-06-02 11:39 | 92K | |
![[SND]](/icons/sound2.gif) | Calendar Nseries.wma | 2019-06-02 11:39 | 92K | |
![[SND]](/icons/sound2.gif) | Sweets.wma | 2019-06-02 11:39 | 92K | |
![[SND]](/icons/sound2.gif) | Tricycle.wma | 2019-06-02 11:39 | 92K | |
![[SND]](/icons/sound2.gif) | Twitter.wma | 2019-06-02 11:39 | 92K | |
![[SND]](/icons/sound2.gif) | Xylophone.wma | 2019-06-02 11:39 | 92K | |
![[SND]](/icons/sound2.gif) | Aquamarine.wma | 2019-06-02 11:39 | 93K | |
![[SND]](/icons/sound2.gif) | Low.wma | 2019-06-02 11:39 | 93K | |
![[SND]](/icons/sound2.gif) | Ruby.wma | 2019-06-02 11:39 | 93K | |
![[SND]](/icons/sound2.gif) | Calendar Xseries.wma | 2019-06-02 11:39 | 98K | |
![[SND]](/icons/sound2.gif) | Rides.wma | 2019-06-02 11:39 | 98K | |
![[SND]](/icons/sound2.gif) | Ringing.wma | 2019-06-02 11:39 | 98K | |
![[SND]](/icons/sound2.gif) | Tinker.wma | 2019-06-02 11:39 | 98K | |
![[SND]](/icons/sound2.gif) | Peal.wma | 2019-06-02 11:39 | 98K | |
![[SND]](/icons/sound2.gif) | Fete.wma | 2019-06-02 11:39 | 104K | |
![[SND]](/icons/sound2.gif) | Flurry.wma | 2019-06-02 11:39 | 104K | |
![[SND]](/icons/sound2.gif) | Imperial.wma | 2019-06-02 11:39 | 104K | |
![[SND]](/icons/sound2.gif) | Leap.wma | 2019-06-02 11:39 | 104K | |
![[SND]](/icons/sound2.gif) | Lure.wma | 2019-06-02 11:39 | 104K | |
![[SND]](/icons/sound2.gif) | Nick of Time.wma | 2019-06-02 11:39 | 104K | |
![[SND]](/icons/sound2.gif) | Nokia Tune (2002).wma | 2019-06-02 11:39 | 104K | |
![[SND]](/icons/sound2.gif) | Nostalgia.wma | 2019-06-02 11:39 | 104K | |
![[SND]](/icons/sound2.gif) | Shine.wma | 2019-06-02 11:39 | 104K | |
![[SND]](/icons/sound2.gif) | Ding Dong.wma | 2019-06-02 11:39 | 104K | |
![[SND]](/icons/sound2.gif) | Bowl.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Calendar 6.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Flight.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Glass.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Jumping.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Kick.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Locomotive.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Rattle.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Scatter.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Stack.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Turquoise.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Wood Bell.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Nokia Tune (2004).wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Space Shield.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Applause.wma | 2019-06-02 11:39 | 110K | |
![[SND]](/icons/sound2.gif) | Calendar Cseries.wma | 2019-06-02 11:39 | 116K | |
![[SND]](/icons/sound2.gif) | Caprice.wma | 2019-06-02 11:39 | 116K | |
![[SND]](/icons/sound2.gif) | Cavalier.wma | 2019-06-02 11:39 | 116K | |
![[SND]](/icons/sound2.gif) | Intro.wma | 2019-06-02 11:39 | 116K | |
![[SND]](/icons/sound2.gif) | Marina.wma | 2019-06-02 11:39 | 116K | |
![[SND]](/icons/sound2.gif) | Pinball.wma | 2019-06-02 11:39 | 116K | |
![[SND]](/icons/sound2.gif) | Rapid.wma | 2019-06-02 11:39 | 116K | |
![[SND]](/icons/sound2.gif) | Vent.wma | 2019-06-02 11:39 | 116K | |
![[SND]](/icons/sound2.gif) | Crystal.wma | 2019-06-02 11:39 | 122K | |
![[SND]](/icons/sound2.gif) | Ding.wma | 2019-06-02 11:39 | 122K | |
![[SND]](/icons/sound2.gif) | Happy Chord.wma | 2019-06-02 11:39 | 122K | |
![[SND]](/icons/sound2.gif) | Mashie.wma | 2019-06-02 11:39 | 122K | |
![[SND]](/icons/sound2.gif) | Spring Toy.wma | 2019-06-02 11:39 | 122K | |
![[SND]](/icons/sound2.gif) | Timer.wma | 2019-06-02 11:39 | 122K | |
![[SND]](/icons/sound2.gif) | Just for Kids.wma | 2019-06-02 11:39 | 127K | |
![[SND]](/icons/sound2.gif) | Runs.wma | 2019-06-02 11:39 | 133K | |
![[SND]](/icons/sound2.gif) | Vertex.wma | 2019-06-02 11:39 | 133K | |
![[SND]](/icons/sound2.gif) | Heather.wma | 2019-06-02 11:39 | 133K | |
![[SND]](/icons/sound2.gif) | Dawning.wma | 2019-06-02 11:39 | 139K | |
![[SND]](/icons/sound2.gif) | Ecliptic.wma | 2019-06-02 11:39 | 139K | |
![[SND]](/icons/sound2.gif) | Fried.wma | 2019-06-02 11:39 | 139K | |
![[SND]](/icons/sound2.gif) | Macro.wma | 2019-06-02 11:39 | 139K | |
![[SND]](/icons/sound2.gif) | Robo IO.wma | 2019-06-02 11:39 | 139K | |
![[SND]](/icons/sound2.gif) | Motorway.wma | 2019-06-02 11:39 | 139K | |
![[SND]](/icons/sound2.gif) | Minima.wma | 2019-06-02 11:39 | 145K | |
![[SND]](/icons/sound2.gif) | Incoming.wma | 2019-06-02 11:39 | 145K | |
![[SND]](/icons/sound2.gif) | Lime Tree.wma | 2019-06-02 11:39 | 145K | |
![[SND]](/icons/sound2.gif) | Goblin.wma | 2019-06-02 11:39 | 151K | |
![[SND]](/icons/sound2.gif) | Klavier.wma | 2019-06-02 11:39 | 151K | |
![[SND]](/icons/sound2.gif) | Synloop.wma | 2019-06-02 11:39 | 151K | |
![[SND]](/icons/sound2.gif) | Dynamic.wma | 2019-06-02 11:39 | 157K | |
![[SND]](/icons/sound2.gif) | Kaleidoscope.wma | 2019-06-02 11:39 | 157K | |
![[SND]](/icons/sound2.gif) | Purple.wma | 2019-06-02 11:39 | 157K | |
![[SND]](/icons/sound2.gif) | Quadratic.wma | 2019-06-02 11:39 | 157K | |
![[SND]](/icons/sound2.gif) | Wasp.wma | 2019-06-02 11:39 | 157K | |
![[SND]](/icons/sound2.gif) | Belly Dance.wma | 2019-06-02 11:39 | 162K | |
![[SND]](/icons/sound2.gif) | Delays.wma | 2019-06-02 11:39 | 162K | |
![[SND]](/icons/sound2.gif) | Espresso.wma | 2019-06-02 11:39 | 162K | |
![[SND]](/icons/sound2.gif) | Pineapple Dance.wma | 2019-06-02 11:39 | 162K | |
![[SND]](/icons/sound2.gif) | Sand Golem.wma | 2019-06-02 11:39 | 162K | |
![[SND]](/icons/sound2.gif) | Bugler.wma | 2019-06-02 11:39 | 168K | |
![[SND]](/icons/sound2.gif) | Clock 1 (1999).wma | 2019-06-02 11:39 | 168K | |
![[SND]](/icons/sound2.gif) | Clock 30 (Gamelan).wma | 2019-06-02 11:39 | 168K | |
![[SND]](/icons/sound2.gif) | Prowl.wma | 2019-06-02 11:39 | 168K | |
![[SND]](/icons/sound2.gif) | Titanics.wma | 2019-06-02 11:39 | 168K | |
![[SND]](/icons/sound2.gif) | Braindrenelin.wma | 2019-06-02 11:39 | 174K | |
![[SND]](/icons/sound2.gif) | Here.wma | 2019-06-02 11:39 | 174K | |
![[SND]](/icons/sound2.gif) | Lumina.wma | 2019-06-02 11:39 | 174K | |
![[SND]](/icons/sound2.gif) | Marionette.wma | 2019-06-02 11:39 | 174K | |
![[SND]](/icons/sound2.gif) | Silk.wma | 2019-06-02 11:39 | 174K | |
![[SND]](/icons/sound2.gif) | Tap Dance.wma | 2019-06-02 11:39 | 174K | |
![[SND]](/icons/sound2.gif) | Botnia.wma | 2019-06-02 11:39 | 180K | |
![[SND]](/icons/sound2.gif) | Subtile.wma | 2019-06-02 11:39 | 180K | |
![[SND]](/icons/sound2.gif) | Brilliant.wma | 2019-06-02 11:39 | 186K | |
![[SND]](/icons/sound2.gif) | Flavors.wma | 2019-06-02 11:39 | 186K | |
![[SND]](/icons/sound2.gif) | Playing Tricks.wma | 2019-06-02 11:39 | 192K | |
![[SND]](/icons/sound2.gif) | Yellowish.wma | 2019-06-02 11:39 | 192K | |
![[SND]](/icons/sound2.gif) | Ceramic.wma | 2019-06-02 11:39 | 197K | |
![[SND]](/icons/sound2.gif) | Clowns.wma | 2019-06-02 11:39 | 197K | |
![[SND]](/icons/sound2.gif) | Luminosity.wma | 2019-06-02 11:39 | 197K | |
![[SND]](/icons/sound2.gif) | Pearl.wma | 2019-06-02 11:39 | 197K | |
![[SND]](/icons/sound2.gif) | Rest.wma | 2019-06-02 11:39 | 197K | |
![[SND]](/icons/sound2.gif) | Sapphire.wma | 2019-06-02 11:39 | 197K | |
![[SND]](/icons/sound2.gif) | Retrobot.wma | 2019-06-02 11:39 | 203K | |
![[SND]](/icons/sound2.gif) | Sky-Blue Blimp.wma | 2019-06-02 11:39 | 203K | |
![[SND]](/icons/sound2.gif) | Snowl.wma | 2019-06-02 11:39 | 203K | |
![[SND]](/icons/sound2.gif) | Staggered.wma | 2019-06-02 11:39 | 203K | |
![[SND]](/icons/sound2.gif) | Tropic.wma | 2019-06-02 11:39 | 203K | |
![[SND]](/icons/sound2.gif) | Thistle.wma | 2019-06-02 11:39 | 209K | |
![[SND]](/icons/sound2.gif) | Trails.wma | 2019-06-02 11:39 | 209K | |
![[SND]](/icons/sound2.gif) | Whistling.wma | 2019-06-02 11:39 | 209K | |
![[SND]](/icons/sound2.gif) | Cat.wma | 2019-06-02 11:39 | 215K | |
![[SND]](/icons/sound2.gif) | Nokia Progressive.wma | 2019-06-02 11:39 | 215K | |
![[SND]](/icons/sound2.gif) | Rock Scissors.wma | 2019-06-02 11:39 | 215K | |
![[SND]](/icons/sound2.gif) | Tin Can.wma | 2019-06-02 11:39 | 215K | |
![[SND]](/icons/sound2.gif) | Bicycle.wma | 2019-06-02 11:39 | 215K | |
![[SND]](/icons/sound2.gif) | Sky-High.wma | 2019-06-02 11:39 | 215K | |
![[SND]](/icons/sound2.gif) | Clock 17 (Beeper).wma | 2019-06-02 11:39 | 221K | |
![[SND]](/icons/sound2.gif) | Doughnut.wma | 2019-06-02 11:39 | 221K | |
![[SND]](/icons/sound2.gif) | Exhilaration.wma | 2019-06-02 11:39 | 221K | |
![[SND]](/icons/sound2.gif) | Harmonic.wma | 2019-06-02 11:39 | 221K | |
![[SND]](/icons/sound2.gif) | Nokiorchestra.wma | 2019-06-02 11:39 | 221K | |
![[SND]](/icons/sound2.gif) | Raindrops.wma | 2019-06-02 11:39 | 221K | |
![[SND]](/icons/sound2.gif) | Ahoy.wma | 2019-06-02 11:39 | 227K | |
![[SND]](/icons/sound2.gif) | Atmos.wma | 2019-06-02 11:39 | 227K | |
![[SND]](/icons/sound2.gif) | Clock 10 (Classic).wma | 2019-06-02 11:39 | 227K | |
![[SND]](/icons/sound2.gif) | Dusk.wma | 2019-06-02 11:39 | 227K | |
![[SND]](/icons/sound2.gif) | Kind.wma | 2019-06-02 11:39 | 227K | |
![[SND]](/icons/sound2.gif) | Nokia Tune.wma | 2019-06-02 11:39 | 227K | |
![[SND]](/icons/sound2.gif) | Calendar Eseries.wma | 2019-06-02 11:39 | 232K | |
![[SND]](/icons/sound2.gif) | Contraflow.wma | 2019-06-02 11:39 | 232K | |
![[SND]](/icons/sound2.gif) | Crop Circle.wma | 2019-06-02 11:39 | 232K | |
![[SND]](/icons/sound2.gif) | High-Speed Rail.wma | 2019-06-02 11:39 | 232K | |
![[SND]](/icons/sound2.gif) | Nokia Music Box.wma | 2019-06-02 11:39 | 232K | |
![[SND]](/icons/sound2.gif) | Nokia Pure Redux.wma | 2019-06-02 11:39 | 232K | |
![[SND]](/icons/sound2.gif) | Progression.wma | 2019-06-02 11:39 | 232K | |
![[SND]](/icons/sound2.gif) | Retro.wma | 2019-06-02 11:39 | 232K | |
![[SND]](/icons/sound2.gif) | Re-Groove.wma | 2019-06-02 11:39 | 233K | |
![[SND]](/icons/sound2.gif) | Landscape.wma | 2019-06-02 11:39 | 238K | |
![[SND]](/icons/sound2.gif) | Megapolis.wma | 2019-06-02 11:39 | 238K | |
![[SND]](/icons/sound2.gif) | Trade.wma | 2019-06-02 11:39 | 238K | |
![[SND]](/icons/sound2.gif) | Bird Box.wma | 2019-06-02 11:39 | 244K | |
![[SND]](/icons/sound2.gif) | Bonus.wma | 2019-06-02 11:39 | 244K | |
![[SND]](/icons/sound2.gif) | Clock 16 (Radar).wma | 2019-06-02 11:39 | 244K | |
![[SND]](/icons/sound2.gif) | Fire Plectrum.wma | 2019-06-02 11:39 | 244K | |
![[SND]](/icons/sound2.gif) | Licks.wma | 2019-06-02 11:39 | 244K | |
![[SND]](/icons/sound2.gif) | Lost in Space.wma | 2019-06-02 11:39 | 244K | |
![[SND]](/icons/sound2.gif) | Machines.wma | 2019-06-02 11:39 | 244K | |
![[SND]](/icons/sound2.gif) | Springtime.wma | 2019-06-02 11:39 | 244K | |
![[SND]](/icons/sound2.gif) | Tinkly.wma | 2019-06-02 11:39 | 244K | |
![[SND]](/icons/sound2.gif) | Clock 13 (Universe).wma | 2019-06-02 11:39 | 250K | |
![[SND]](/icons/sound2.gif) | Eyelid.wma | 2019-06-02 11:39 | 250K | |
![[SND]](/icons/sound2.gif) | Fizz.wma | 2019-06-02 11:39 | 250K | |
![[SND]](/icons/sound2.gif) | Lush.wma | 2019-06-02 11:39 | 250K | |
![[SND]](/icons/sound2.gif) | Seamless.wma | 2019-06-02 11:39 | 250K | |
![[SND]](/icons/sound2.gif) | Toys.wma | 2019-06-02 11:39 | 250K | |
![[SND]](/icons/sound2.gif) | Pepper.wma | 2019-06-02 11:39 | 250K | |
![[SND]](/icons/sound2.gif) | Bouganville.wma | 2019-06-02 11:39 | 256K | |
![[SND]](/icons/sound2.gif) | Electra.wma | 2019-06-02 11:39 | 256K | |
![[SND]](/icons/sound2.gif) | Forest Lake.wma | 2019-06-02 11:39 | 256K | |
![[SND]](/icons/sound2.gif) | Just Ice.wma | 2019-06-02 11:39 | 256K | |
![[SND]](/icons/sound2.gif) | Radial.wma | 2019-06-02 11:39 | 256K | |
![[SND]](/icons/sound2.gif) | Seahorse.wma | 2019-06-02 11:39 | 256K | |
![[SND]](/icons/sound2.gif) | Sinesong.wma | 2019-06-02 11:39 | 256K | |
![[SND]](/icons/sound2.gif) | Vibe.wma | 2019-06-02 11:39 | 256K | |
![[SND]](/icons/sound2.gif) | Clock 12 (Explore).wma | 2019-06-02 11:39 | 262K | |
![[SND]](/icons/sound2.gif) | Clock 15 (Shapes).wma | 2019-06-02 11:39 | 262K | |
![[SND]](/icons/sound2.gif) | Clock Cseries.wma | 2019-06-02 11:39 | 262K | |
![[SND]](/icons/sound2.gif) | Eastern Forest.wma | 2019-06-02 11:39 | 262K | |
![[SND]](/icons/sound2.gif) | Re-Rumble.wma | 2019-06-02 11:39 | 262K | |
![[SND]](/icons/sound2.gif) | Ripple.wma | 2019-06-02 11:39 | 262K | |
![[SND]](/icons/sound2.gif) | Coil.wma | 2019-06-02 11:39 | 267K | |
![[SND]](/icons/sound2.gif) | Coral Reef.wma | 2019-06-02 11:39 | 267K | |
![[SND]](/icons/sound2.gif) | Mingle.wma | 2019-06-02 11:39 | 267K | |
![[SND]](/icons/sound2.gif) | Nokia Hybrid Guitar.wma | 2019-06-02 11:39 | 267K | |
![[SND]](/icons/sound2.gif) | Polar Light.wma | 2019-06-02 11:39 | 267K | |
![[SND]](/icons/sound2.gif) | Shades.wma | 2019-06-02 11:39 | 267K | |
![[SND]](/icons/sound2.gif) | Voyage.wma | 2019-06-02 11:39 | 267K | |
![[SND]](/icons/sound2.gif) | Warm.wma | 2019-06-02 11:39 | 267K | |
![[SND]](/icons/sound2.gif) | What's Up.wma | 2019-06-02 11:39 | 268K | |
![[SND]](/icons/sound2.gif) | Bionic.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Bluet.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Brikabrak.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Canvas.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Conjunction.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Duel.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Emile.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Nails.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Vortex.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Wheels.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Zen.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Too Hot.wma | 2019-06-02 11:39 | 273K | |
![[SND]](/icons/sound2.gif) | Harptivox.wma | 2019-06-02 11:39 | 279K | |
![[SND]](/icons/sound2.gif) | Mirror Image.wma | 2019-06-02 11:39 | 279K | |
![[SND]](/icons/sound2.gif) | Modulation.wma | 2019-06-02 11:39 | 279K | |
![[SND]](/icons/sound2.gif) | Water Ring.wma | 2019-06-02 11:39 | 279K | |
![[SND]](/icons/sound2.gif) | Ahh Glitch.wma | 2019-06-02 11:39 | 285K | |
![[SND]](/icons/sound2.gif) | Astrosphere.wma | 2019-06-02 11:39 | 285K | |
![[SND]](/icons/sound2.gif) | Bit Crush.wma | 2019-06-02 11:39 | 285K | |
![[SND]](/icons/sound2.gif) | Clock 9 (Peaceful).wma | 2019-06-02 11:39 | 285K | |
![[SND]](/icons/sound2.gif) | Elevator.wma | 2019-06-02 11:39 | 285K | |
![[SND]](/icons/sound2.gif) | Elves.wma | 2019-06-02 11:39 | 285K | |
![[SND]](/icons/sound2.gif) | Fisheye.wma | 2019-06-02 11:39 | 285K | |
![[SND]](/icons/sound2.gif) | Foliage.wma | 2019-06-02 11:39 | 285K | |
![[SND]](/icons/sound2.gif) | Silvan Pond.wma | 2019-06-02 11:39 | 285K | |
![[SND]](/icons/sound2.gif) | Tick.wma | 2019-06-02 11:39 | 285K | |
![[SND]](/icons/sound2.gif) | Backpacker.wma | 2019-06-02 11:39 | 291K | |
![[SND]](/icons/sound2.gif) | Chilled.wma | 2019-06-02 11:39 | 291K | |
![[SND]](/icons/sound2.gif) | Density.wma | 2019-06-02 11:39 | 291K | |
![[SND]](/icons/sound2.gif) | Dotted.wma | 2019-06-02 11:39 | 291K | |
![[SND]](/icons/sound2.gif) | Keypumper.wma | 2019-06-02 11:39 | 291K | |
![[SND]](/icons/sound2.gif) | Steely.wma | 2019-06-02 11:39 | 291K | |
![[SND]](/icons/sound2.gif) | Calm.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Clock 3 (Cadenza).wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Edgy.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Flotilla.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Good Times.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Keys.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Numeric.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Pastures.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Snapdragon.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Soda Pop.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Surface.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Trill.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Fast-Flying.wma | 2019-06-02 11:39 | 297K | |
![[SND]](/icons/sound2.gif) | Butterfly.wma | 2019-06-02 11:39 | 302K | |
![[SND]](/icons/sound2.gif) | Clock 1 (2007).wma | 2019-06-02 11:39 | 302K | |
![[SND]](/icons/sound2.gif) | Daytime.wma | 2019-06-02 11:39 | 302K | |
![[SND]](/icons/sound2.gif) | Flat Cats.wma | 2019-06-02 11:39 | 302K | |
![[SND]](/icons/sound2.gif) | Outer space.wma | 2019-06-02 11:39 | 302K | |
![[SND]](/icons/sound2.gif) | Solar Eclipse.wma | 2019-06-02 11:39 | 302K | |
![[SND]](/icons/sound2.gif) | Walk Away.wma | 2019-06-02 11:39 | 302K | |
![[SND]](/icons/sound2.gif) | Budgerigar.wma | 2019-06-02 11:39 | 303K | |
![[SND]](/icons/sound2.gif) | Builder.wma | 2019-06-02 11:39 | 308K | |
![[SND]](/icons/sound2.gif) | Halcyon.wma | 2019-06-02 11:39 | 308K | |
![[SND]](/icons/sound2.gif) | Hello.wma | 2019-06-02 11:39 | 308K | |
![[SND]](/icons/sound2.gif) | Magnetism.wma | 2019-06-02 11:39 | 308K | |
![[SND]](/icons/sound2.gif) | Nokia Cappella.wma | 2019-06-02 11:39 | 308K | |
![[SND]](/icons/sound2.gif) | Openings.wma | 2019-06-02 11:39 | 308K | |
![[SND]](/icons/sound2.gif) | Pitch Bubbles.wma | 2019-06-02 11:39 | 308K | |
![[SND]](/icons/sound2.gif) | Right This Moment.wma | 2019-06-02 11:39 | 308K | |
![[SND]](/icons/sound2.gif) | Runway.wma | 2019-06-02 11:39 | 308K | |
![[SND]](/icons/sound2.gif) | Silhouette.wma | 2019-06-02 11:39 | 308K | |
![[SND]](/icons/sound2.gif) | Baby Rhino.wma | 2019-06-02 11:39 | 314K | |
![[SND]](/icons/sound2.gif) | Blackbird.wma | 2019-06-02 11:39 | 314K | |
![[SND]](/icons/sound2.gif) | Lead.wma | 2019-06-02 11:39 | 314K | |
![[SND]](/icons/sound2.gif) | Like I Care.wma | 2019-06-02 11:39 | 314K | |
![[SND]](/icons/sound2.gif) | Schubert.wma | 2019-06-02 11:39 | 314K | |
![[SND]](/icons/sound2.gif) | Swish.wma | 2019-06-02 11:39 | 314K | |
![[SND]](/icons/sound2.gif) | Timid.wma | 2019-06-02 11:39 | 314K | |
![[SND]](/icons/sound2.gif) | Waterways.wma | 2019-06-02 11:39 | 314K | |
![[SND]](/icons/sound2.gif) | Breeze.wma | 2019-06-02 11:39 | 320K | |
![[SND]](/icons/sound2.gif) | Chipper.wma | 2019-06-02 11:39 | 320K | |
![[SND]](/icons/sound2.gif) | Come and Play.wma | 2019-06-02 11:39 | 320K | |
![[SND]](/icons/sound2.gif) | Fuse.wma | 2019-06-02 11:39 | 320K | |
![[SND]](/icons/sound2.gif) | Iron.wma | 2019-06-02 11:39 | 320K | |
![[SND]](/icons/sound2.gif) | Luminance.wma | 2019-06-02 11:39 | 320K | |
![[SND]](/icons/sound2.gif) | Metro.wma | 2019-06-02 11:39 | 320K | |
![[SND]](/icons/sound2.gif) | Nokia Tune (2011).wma | 2019-06-02 11:39 | 320K | |
![[SND]](/icons/sound2.gif) | Rain Shower.wma | 2019-06-02 11:39 | 320K | |
![[SND]](/icons/sound2.gif) | Shimmer.wma | 2019-06-02 11:39 | 320K | |
![[SND]](/icons/sound2.gif) | The Trick.wma | 2019-06-02 11:39 | 320K | |
![[SND]](/icons/sound2.gif) | Aa.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Aethereal.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Charade.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Clock 18 (Brand).wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Clock 26 (Odyssey).wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Fades.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Freeze.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Hearts and Minds.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Lift Off.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Scooped.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Wisp.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Wiz Bang.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Blue Pause.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Hunted.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Curl.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Telescope.wma | 2019-06-02 11:39 | 326K | |
![[SND]](/icons/sound2.gif) | Arcade.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Blip.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Brill.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Clear Blue Sky.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Countryside.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Destiny.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Electric.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Frenzy.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Gotta Have.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Jink.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Maximize.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Nodular.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Shimmy.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Skittle.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Spring Field.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Wired Up.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Wolfgang.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Everlasting.wma | 2019-06-02 11:39 | 332K | |
![[SND]](/icons/sound2.gif) | Aires.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Break.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Celestine.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Dominator.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Gritty.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Idim.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Magicked.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Miracle.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Perch.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Placebo.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Pure.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Retroverse.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Sanicle.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Snow.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Walk in the Park.wma | 2019-06-02 11:39 | 338K | |
![[SND]](/icons/sound2.gif) | Blue Curve.wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Bobble.wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Clock 4 (Chirr).wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Coconut.wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Fat Scratch.wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Freeheart.wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Glint.wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Lucky Five.wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Prism.wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Punch.wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Sumatra Ring.wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Woods.wma | 2019-06-02 11:39 | 343K | |
![[SND]](/icons/sound2.gif) | Black Hole.wma | 2019-06-02 11:39 | 349K | |
![[SND]](/icons/sound2.gif) | Bourne.wma | 2019-06-02 11:39 | 349K | |
![[SND]](/icons/sound2.gif) | Captain.wma | 2019-06-02 11:39 | 349K | |
![[SND]](/icons/sound2.gif) | Catwalk.wma | 2019-06-02 11:39 | 349K | |
![[SND]](/icons/sound2.gif) | Glitter.wma | 2019-06-02 11:39 | 349K | |
![[SND]](/icons/sound2.gif) | Ice-Breaker.wma | 2019-06-02 11:39 | 349K | |
![[SND]](/icons/sound2.gif) | Nuance.wma | 2019-06-02 11:39 | 349K | |
![[SND]](/icons/sound2.gif) | Sensation.wma | 2019-06-02 11:39 | 349K | |
![[SND]](/icons/sound2.gif) | Specialist.wma | 2019-06-02 11:39 | 349K | |
![[SND]](/icons/sound2.gif) | Tender.wma | 2019-06-02 11:39 | 349K | |
![[SND]](/icons/sound2.gif) | Vinyl Style.wma | 2019-06-02 11:39 | 349K | |
![[SND]](/icons/sound2.gif) | Coalesce.wma | 2019-06-02 11:39 | 355K | |
![[SND]](/icons/sound2.gif) | Glare.wma | 2019-06-02 11:39 | 355K | |
![[SND]](/icons/sound2.gif) | Heat Wave.wma | 2019-06-02 11:39 | 355K | |
![[SND]](/icons/sound2.gif) | Sparkles.wma | 2019-06-02 11:39 | 355K | |
![[SND]](/icons/sound2.gif) | United.wma | 2019-06-02 11:39 | 355K | |
![[SND]](/icons/sound2.gif) | Vivid Matt.wma | 2019-06-02 11:39 | 355K | |
![[SND]](/icons/sound2.gif) | Wah Wah.wma | 2019-06-02 11:39 | 355K | |
![[SND]](/icons/sound2.gif) | Walking.wma | 2019-06-02 11:39 | 355K | |
![[SND]](/icons/sound2.gif) | Glacier.wma | 2019-06-02 11:39 | 355K | |
![[SND]](/icons/sound2.gif) | Spell.wma | 2019-06-02 11:39 | 355K | |
![[SND]](/icons/sound2.gif) | Centric.wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | China Spirit.wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | Clock 29 (Pop).wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | Danceholic.wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | Floating.wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | Fondant.wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | Milieu.wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | Moanday.wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | Myriads of Stars.wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | Mystique.wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | Nova.wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | Triple Rainbow.wma | 2019-06-02 11:39 | 361K | |
![[SND]](/icons/sound2.gif) | Axial.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Be Movin'.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Blom.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Bustle.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Cottage.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Dancers.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Discovery.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Miniature.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Nocturne.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Poolside.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Sunny Day.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Synaptic Jolt.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Snowfight.wma | 2019-06-02 11:39 | 367K | |
![[SND]](/icons/sound2.gif) | Blank.wma | 2019-06-02 11:39 | 373K | |
![[SND]](/icons/sound2.gif) | Cartouche.wma | 2019-06-02 11:39 | 373K | |
![[SND]](/icons/sound2.gif) | Circle.wma | 2019-06-02 11:39 | 373K | |
![[SND]](/icons/sound2.gif) | Experiment.wma | 2019-06-02 11:39 | 373K | |
![[SND]](/icons/sound2.gif) | Flying.wma | 2019-06-02 11:39 | 373K | |
![[SND]](/icons/sound2.gif) | Futuristico.wma | 2019-06-02 11:39 | 373K | |
![[SND]](/icons/sound2.gif) | Lounge.wma | 2019-06-02 11:39 | 373K | |
![[SND]](/icons/sound2.gif) | Minuscular.wma | 2019-06-02 11:39 | 373K | |
![[SND]](/icons/sound2.gif) | Paragon.wma | 2019-06-02 11:39 | 373K | |
![[SND]](/icons/sound2.gif) | Swimming.wma | 2019-06-02 11:39 | 373K | |
![[SND]](/icons/sound2.gif) | Shuttle.wma | 2019-06-02 11:39 | 373K | |
![[SND]](/icons/sound2.gif) | Aquamarine Dreams.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Beach.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Call Waiting.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Clock 11 (Constellation).wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Dance Floor.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Dewdrop.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Journeys.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Oceanic.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Open.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Retropolis.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Shimmering.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Snake Bite.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Sonar.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Sweet Jamming.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Windbreak.wma | 2019-06-02 11:39 | 378K | |
![[SND]](/icons/sound2.gif) | Clock 7 (Clocksmith).wma | 2019-06-02 11:39 | 384K | |
![[SND]](/icons/sound2.gif) | Glassware.wma | 2019-06-02 11:39 | 384K | |
![[SND]](/icons/sound2.gif) | Hushed.wma | 2019-06-02 11:39 | 384K | |
![[SND]](/icons/sound2.gif) | Mercurial.wma | 2019-06-02 11:39 | 384K | |
![[SND]](/icons/sound2.gif) | Reactive.wma | 2019-06-02 11:39 | 384K | |
![[SND]](/icons/sound2.gif) | Brittle.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Clock Xseries.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Dancy.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Elecredible.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Float.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Golden.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Orb.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Pebble.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Project.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Sublunar.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Summer Fruit.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Swipper.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | The Big Dragon.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Valve.wma | 2019-06-02 11:39 | 390K | |
![[SND]](/icons/sound2.gif) | Breakable Beat.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Coast Drive.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Construction.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Crystals.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | En Route.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Flamboy.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Memory.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Nanomal.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Need You.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Nokia Tune Remix.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Octopus.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Pixel.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Purplex.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Quartz.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Ringabout.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Ringmod.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Rising.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Springlike.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Vinyl.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Warped.wma | 2019-06-02 11:39 | 396K | |
![[SND]](/icons/sound2.gif) | Airborne.wma | 2019-06-02 11:39 | 402K | |
![[SND]](/icons/sound2.gif) | Brimful.wma | 2019-06-02 11:39 | 402K | |
![[SND]](/icons/sound2.gif) | Circles.wma | 2019-06-02 11:39 | 402K | |
![[SND]](/icons/sound2.gif) | Deep Red Funk.wma | 2019-06-02 11:39 | 402K | |
![[SND]](/icons/sound2.gif) | Ice Tone.wma | 2019-06-02 11:39 | 402K | |
![[SND]](/icons/sound2.gif) | Valley.wma | 2019-06-02 11:39 | 402K | |
![[SND]](/icons/sound2.gif) | Looking Glass.wma | 2019-06-02 11:39 | 408K | |
![[SND]](/icons/sound2.gif) | Robot.wma | 2019-06-02 11:39 | 408K | |
![[SND]](/icons/sound2.gif) | Silver.wma | 2019-06-02 11:39 | 408K | |
![[SND]](/icons/sound2.gif) | Brooklet.wma | 2019-06-02 11:39 | 413K | |
![[SND]](/icons/sound2.gif) | Chatter.wma | 2019-06-02 11:39 | 413K | |
![[SND]](/icons/sound2.gif) | Com Voce.wma | 2019-06-02 11:39 | 413K | |
![[SND]](/icons/sound2.gif) | Evening.wma | 2019-06-02 11:39 | 413K | |
![[SND]](/icons/sound2.gif) | Gossip.wma | 2019-06-02 11:39 | 413K | |
![[SND]](/icons/sound2.gif) | Metamorphosis.wma | 2019-06-02 11:39 | 413K | |
![[SND]](/icons/sound2.gif) | Starsign.wma | 2019-06-02 11:39 | 413K | |
![[SND]](/icons/sound2.gif) | Tribal.wma | 2019-06-02 11:39 | 413K | |
![[SND]](/icons/sound2.gif) | Flow.wma | 2019-06-02 11:39 | 414K | |
![[SND]](/icons/sound2.gif) | Africa Vibe.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Catalyst.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Clock 27 (Walk).wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Flash Sparkle.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Fury.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Nature.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Nocturnal.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Old Times.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Pose.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Seduction.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Skyward.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Stadium.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Violet.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Weave.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Zee Beam.wma | 2019-06-02 11:39 | 419K | |
![[SND]](/icons/sound2.gif) | Endless Flow.wma | 2019-06-02 11:39 | 425K | |
![[SND]](/icons/sound2.gif) | Higher.wma | 2019-06-02 11:39 | 425K | |
![[SND]](/icons/sound2.gif) | Magical.wma | 2019-06-02 11:39 | 425K | |
![[SND]](/icons/sound2.gif) | Night Shimmer.wma | 2019-06-02 11:39 | 425K | |
![[SND]](/icons/sound2.gif) | Nokia New Generation.wma | 2019-06-02 11:39 | 425K | |
![[SND]](/icons/sound2.gif) | Silver (Original).wma | 2019-06-02 11:39 | 425K | |
![[SND]](/icons/sound2.gif) | Slow Coffee.wma | 2019-06-02 11:39 | 425K | |
![[SND]](/icons/sound2.gif) | Univere.wma | 2019-06-02 11:39 | 425K | |
![[SND]](/icons/sound2.gif) | Voices.wma | 2019-06-02 11:39 | 425K | |
![[SND]](/icons/sound2.gif) | Wondercall.wma | 2019-06-02 11:39 | 425K | |
![[SND]](/icons/sound2.gif) | Clock 14 (Timekeeper).wma | 2019-06-02 11:39 | 431K | |
![[SND]](/icons/sound2.gif) | Destination.wma | 2019-06-02 11:39 | 431K | |
![[SND]](/icons/sound2.gif) | Drip Groove.wma | 2019-06-02 11:39 | 431K | |
![[SND]](/icons/sound2.gif) | Electricity.wma | 2019-06-02 11:39 | 431K | |
![[SND]](/icons/sound2.gif) | Euphoria.wma | 2019-06-02 11:39 | 431K | |
![[SND]](/icons/sound2.gif) | Rock.wma | 2019-06-02 11:39 | 431K | |
![[SND]](/icons/sound2.gif) | Santoor Fusion.wma | 2019-06-02 11:39 | 431K | |
![[SND]](/icons/sound2.gif) | Acceleration.wma | 2019-06-02 11:39 | 437K | |
![[SND]](/icons/sound2.gif) | Astrum.wma | 2019-06-02 11:39 | 437K | |
![[SND]](/icons/sound2.gif) | Clock Eseries.wma | 2019-06-02 11:39 | 437K | |
![[SND]](/icons/sound2.gif) | Counterflow.wma | 2019-06-02 11:39 | 437K | |
![[SND]](/icons/sound2.gif) | Crush.wma | 2019-06-02 11:39 | 437K | |
![[SND]](/icons/sound2.gif) | Mexican Hat Dance.wma | 2019-06-02 11:39 | 437K | |
![[SND]](/icons/sound2.gif) | Moderate.wma | 2019-06-02 11:39 | 437K | |
![[SND]](/icons/sound2.gif) | Smoky Eyes.wma | 2019-06-02 11:39 | 437K | |
![[SND]](/icons/sound2.gif) | Straightway.wma | 2019-06-02 11:39 | 437K | |
![[SND]](/icons/sound2.gif) | Synthesizer.wma | 2019-06-02 11:39 | 437K | |
![[SND]](/icons/sound2.gif) | Appearance.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Computer OK.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Flashes of Brilliance.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | La Luna.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Latin Pep.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Sashay.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Silvery Bright.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Skate.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Soulful.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Tides.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Travels.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Tropicasia.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Waiting.wma | 2019-06-02 11:39 | 443K | |
![[SND]](/icons/sound2.gif) | Astir.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Clock 25 (Arcade).wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Debussy.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Electric Eel.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Electrode.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Miniature of Pond.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | O Sol.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Plastic.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Safari.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Skysail.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Tap Circle.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Tickle.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Timeless.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Tropical.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Twinkle.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Worm.wma | 2019-06-02 11:39 | 448K | |
![[SND]](/icons/sound2.gif) | Beijing Lantern.wma | 2019-06-02 11:39 | 454K | |
![[SND]](/icons/sound2.gif) | Bouncey Bounce.wma | 2019-06-02 11:39 | 454K | |
![[SND]](/icons/sound2.gif) | Clock 20 (Ensemble).wma | 2019-06-02 11:39 | 454K | |
![[SND]](/icons/sound2.gif) | In the Mood.wma | 2019-06-02 11:39 | 454K | |
![[SND]](/icons/sound2.gif) | Lounging.wma | 2019-06-02 11:39 | 454K | |
![[SND]](/icons/sound2.gif) | Pick It Up.wma | 2019-06-02 11:39 | 454K | |
![[SND]](/icons/sound2.gif) | Ploptic.wma | 2019-06-02 11:39 | 454K | |
![[SND]](/icons/sound2.gif) | Simply African.wma | 2019-06-02 11:39 | 454K | |
![[SND]](/icons/sound2.gif) | Startup.wma | 2019-06-02 11:39 | 454K | |
![[SND]](/icons/sound2.gif) | Warm at Heart.wma | 2019-06-02 11:39 | 454K | |
![[SND]](/icons/sound2.gif) | Whoop.wma | 2019-06-02 11:39 | 454K | |
![[SND]](/icons/sound2.gif) | Edges.wma | 2019-06-02 11:39 | 460K | |
![[SND]](/icons/sound2.gif) | Feliciana.wma | 2019-06-02 11:39 | 460K | |
![[SND]](/icons/sound2.gif) | Fixate.wma | 2019-06-02 11:39 | 460K | |
![[SND]](/icons/sound2.gif) | Rosewood.wma | 2019-06-02 11:39 | 460K | |
![[SND]](/icons/sound2.gif) | Rotation.wma | 2019-06-02 11:39 | 460K | |
![[SND]](/icons/sound2.gif) | Trance.wma | 2019-06-02 11:39 | 460K | |
![[SND]](/icons/sound2.gif) | Accent.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Clock 28 (Morning).wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Core.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Delirium.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Digitize.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Flattered.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Heels.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Leaves.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Magic Australia.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Marseilles.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Octaneum.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Sharqi 2.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Sweet Voice.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Hummingbird.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Shout.wma | 2019-06-02 11:39 | 466K | |
![[SND]](/icons/sound2.gif) | Dub.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Graffiti.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Hometown.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Nana.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Positron.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Resonate.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Sharqi 1.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Solution.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Sun Fun.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Sweetie.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | The Peony Pavilion.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Trout.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Windswept.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Island.wma | 2019-06-02 11:39 | 472K | |
![[SND]](/icons/sound2.gif) | Diazinon.wma | 2019-06-02 11:39 | 478K | |
![[SND]](/icons/sound2.gif) | Heavenly.wma | 2019-06-02 11:39 | 478K | |
![[SND]](/icons/sound2.gif) | On My Own.wma | 2019-06-02 11:39 | 478K | |
![[SND]](/icons/sound2.gif) | Outplay.wma | 2019-06-02 11:39 | 478K | |
![[SND]](/icons/sound2.gif) | Transcend.wma | 2019-06-02 11:39 | 478K | |
![[SND]](/icons/sound2.gif) | Victory.wma | 2019-06-02 11:39 | 478K | |
![[SND]](/icons/sound2.gif) | Aqueous.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Crossroad.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Downward.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Flummox.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Glow.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Ice.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Illusionist.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | India Bamboo.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Launch.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Mystic.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Resonant Bliss.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Slap On.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Terrestrial.wma | 2019-06-02 11:39 | 483K | |
![[SND]](/icons/sound2.gif) | Clock 1 (2010).wma | 2019-06-02 11:39 | 484K | |
![[SND]](/icons/sound2.gif) | AlKadaab.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Blue Ice.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Brook.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Chicken Dance.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Chimera.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Clock 1 (2011).wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Clock 1.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Clock 22 (Stones).wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Desert Tender.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Festive.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Happy Hour.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Hitchhiker.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Idea.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Khaleeji Groove.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Ma Aleena.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Morning Light.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Mountaineer.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Optimus.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Oriental Dreams.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Roundabout.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Shuffle Step.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Temporal.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Traversal.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Zanjebar.wma | 2019-06-02 11:39 | 489K | |
![[SND]](/icons/sound2.gif) | Bedouin.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Blossom.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Blue Series.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Bubble.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Clock Nseries.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Concertina.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Disco-Charge.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Earthen.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Espionage.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Free Ooze.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Frequency.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Half Past Twelve.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Lo-Fi.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Marrakech by Night.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Nokya in the Sky.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Pick Up the Phone.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Sparkledust.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Streetwise.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Summer Rain.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Take Away Blues.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Unia.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Westward.wma | 2019-06-02 11:39 | 495K | |
![[SND]](/icons/sound2.gif) | Brache.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Clock 23 (Hang Drum).wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Digital Thump.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Excitement.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Fortune-Teller.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Get On Up.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Instant Replay.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Pacific Song.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Rai Fusion.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Rhymer.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Slapstick.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Smile.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Tranzform.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Trip Hop.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Turbine.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Walking On.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Whales.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Worldly.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Rhodium.wma | 2019-06-02 11:39 | 501K | |
![[SND]](/icons/sound2.gif) | Clock 24 (Space Port).wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Full.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Hamada Wa Totoo.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Happy Hipster.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Indian Rhythm.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Jig.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Kapuas River.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Lighthouse.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Outburst.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Overdrive.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Pasta.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Progressive.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Retrace.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Robotique.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Selekt.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Shining.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Solenoid.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Sprinkle.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Swing By.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Translucent.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Triangle.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Twang.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Venture.wma | 2019-06-02 11:39 | 507K | |
![[SND]](/icons/sound2.gif) | Axiom.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Coming Home.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Eaglestone.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Elgar.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Eternal.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Garden.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Gradual.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Nineties.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Past Times.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Plasma.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Saturn.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Serene.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Sunday Walk.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Tango Dally.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Trike.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Tronic.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Yearn.wma | 2019-06-02 11:39 | 513K | |
![[SND]](/icons/sound2.gif) | Alterna.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Backwoods.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Come Fill Me In.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Do It.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Electric Marimba.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Fitted and Turned.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Mekong Butterfly.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Movin'.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Oriental.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Origin Mridangam.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Return My Call.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Spirit of India.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Stinger.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Summer Beats.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | Yearning.wma | 2019-06-02 11:39 | 518K | |
![[SND]](/icons/sound2.gif) | City Life.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Clock 2 (Wake Up).wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Cocoon.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Discoid.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Drill.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Firefly.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Glitch.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | House.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Pursue.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Reptilian.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Rove.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Spacial.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Stay That Way.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | The Aristocrat.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Unseen.wma | 2019-06-02 11:39 | 524K | |
![[SND]](/icons/sound2.gif) | Ask Love.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Boxes.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Dream of Forever.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Emblazon.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Hope.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Listen.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Momentum.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Reflection.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Resonator.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Shibata.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Sooth.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Subhop.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Wigs.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | You're Walking.wma | 2019-06-02 11:39 | 530K | |
![[SND]](/icons/sound2.gif) | Afternoon.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Back Again.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Colosseum.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Deal.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Desert Wind.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Halokinesis.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Later.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Liquid.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Lucid Dreaming.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Orchid.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Passe-Partout.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Sizzle Brazil.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Stars.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Stellar Light.wma | 2019-06-02 11:39 | 536K | |
![[SND]](/icons/sound2.gif) | Cascades.wma | 2019-06-02 11:39 | 542K | |
![[SND]](/icons/sound2.gif) | Chill.wma | 2019-06-02 11:39 | 542K | |
![[SND]](/icons/sound2.gif) | Helical.wma | 2019-06-02 11:39 | 542K | |
![[SND]](/icons/sound2.gif) | Liquify.wma | 2019-06-02 11:39 | 542K | |
![[SND]](/icons/sound2.gif) | Mouth.wma | 2019-06-02 11:39 | 542K | |
![[SND]](/icons/sound2.gif) | Season's Greetings.wma | 2019-06-02 11:39 | 542K | |
![[SND]](/icons/sound2.gif) | Sundown.wma | 2019-06-02 11:39 | 542K | |
![[SND]](/icons/sound2.gif) | Sunset.wma | 2019-06-02 11:39 | 542K | |
![[SND]](/icons/sound2.gif) | Tumble to the Stars.wma | 2019-06-02 11:39 | 542K | |
![[SND]](/icons/sound2.gif) | Thrilling.wma | 2019-06-02 11:39 | 542K | |
![[SND]](/icons/sound2.gif) | Always Here.wma | 2019-06-02 11:39 | 548K | |
![[SND]](/icons/sound2.gif) | Blue Smoke.wma | 2019-06-02 11:39 | 548K | |
![[SND]](/icons/sound2.gif) | Droplet.wma | 2019-06-02 11:39 | 548K | |
![[SND]](/icons/sound2.gif) | Flute Funk.wma | 2019-06-02 11:39 | 548K | |
![[SND]](/icons/sound2.gif) | Nasal.wma | 2019-06-02 11:39 | 548K | |
![[SND]](/icons/sound2.gif) | Retro Robots.wma | 2019-06-02 11:39 | 548K | |
![[SND]](/icons/sound2.gif) | Soul.wma | 2019-06-02 11:39 | 548K | |
![[SND]](/icons/sound2.gif) | Summer Jam.wma | 2019-06-02 11:39 | 548K | |
![[SND]](/icons/sound2.gif) | Tiptoe.wma | 2019-06-02 11:39 | 548K | |
![[SND]](/icons/sound2.gif) | Woodsman.wma | 2019-06-02 11:39 | 548K | |
![[SND]](/icons/sound2.gif) | Color to My World.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Deep Blue Pixel.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Ebb.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Extracted.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Flux.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Generation.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Grounds.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Incident.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Interlude.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Latin Daze.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Magnetic.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Metropolitan.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Our Day.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Plur.wma | 2019-06-02 11:39 | 553K | |
![[SND]](/icons/sound2.gif) | Feelings.wma | 2019-06-02 11:39 | 554K | |
![[SND]](/icons/sound2.gif) | Activity.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Angle.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Breathing.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Clock 1 (2004).wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Collective.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Dublee.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Fast Track.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Jungle Dream.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Little Shoes.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Neuron Pulse.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Plim.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Satisfied.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Tablet.wma | 2019-06-02 11:39 | 559K | |
![[SND]](/icons/sound2.gif) | Bedrock.wma | 2019-06-02 11:39 | 565K | |
![[SND]](/icons/sound2.gif) | Dobber.wma | 2019-06-02 11:39 | 565K | |
![[SND]](/icons/sound2.gif) | Junction.wma | 2019-06-02 11:39 | 565K | |
![[SND]](/icons/sound2.gif) | Material.wma | 2019-06-02 11:39 | 565K | |
![[SND]](/icons/sound2.gif) | Metropolis.wma | 2019-06-02 11:39 | 565K | |
![[SND]](/icons/sound2.gif) | Randomline.wma | 2019-06-02 11:39 | 565K | |
![[SND]](/icons/sound2.gif) | Repetition.wma | 2019-06-02 11:39 | 565K | |
![[SND]](/icons/sound2.gif) | Riff-a-Ring.wma | 2019-06-02 11:39 | 565K | |
![[SND]](/icons/sound2.gif) | Unicorn.wma | 2019-06-02 11:39 | 565K | |
![[SND]](/icons/sound2.gif) | Flying Snow.wma | 2019-06-02 11:39 | 571K | |
![[SND]](/icons/sound2.gif) | Living Room.wma | 2019-06-02 11:39 | 571K | |
![[SND]](/icons/sound2.gif) | Miniature of Troy.wma | 2019-06-02 11:39 | 571K | |
![[SND]](/icons/sound2.gif) | Plinky Kalinka.wma | 2019-06-02 11:39 | 571K | |
![[SND]](/icons/sound2.gif) | Radiant.wma | 2019-06-02 11:39 | 571K | |
![[SND]](/icons/sound2.gif) | Reversal.wma | 2019-06-02 11:39 | 571K | |
![[SND]](/icons/sound2.gif) | Silkscreen.wma | 2019-06-02 11:39 | 571K | |
![[SND]](/icons/sound2.gif) | Sizzlin'.wma | 2019-06-02 11:39 | 571K | |
![[SND]](/icons/sound2.gif) | Sub-Zero.wma | 2019-06-02 11:39 | 571K | |
![[SND]](/icons/sound2.gif) | Tweet Twoo.wma | 2019-06-02 11:39 | 571K | |
![[SND]](/icons/sound2.gif) | Cello.wma | 2019-06-02 11:39 | 577K | |
![[SND]](/icons/sound2.gif) | Desire.wma | 2019-06-02 11:39 | 577K | |
![[SND]](/icons/sound2.gif) | Mei Gong River.wma | 2019-06-02 11:39 | 577K | |
![[SND]](/icons/sound2.gif) | Mountain Peaks.wma | 2019-06-02 11:39 | 577K | |
![[SND]](/icons/sound2.gif) | Nouveau Rock.wma | 2019-06-02 11:39 | 577K | |
![[SND]](/icons/sound2.gif) | Scalier.wma | 2019-06-02 11:39 | 577K | |
![[SND]](/icons/sound2.gif) | Scratchy.wma | 2019-06-02 11:39 | 577K | |
![[SND]](/icons/sound2.gif) | Strike One.wma | 2019-06-02 11:39 | 577K | |
![[SND]](/icons/sound2.gif) | Clock 21 (Sensual).wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Concertino.wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Contours.wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Dim.wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Eozon.wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Glass Shapes.wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Proximity.wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Punjabi.wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Rise Up.wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Solar.wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Sphere.wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Together.wma | 2019-06-02 11:39 | 583K | |
![[SND]](/icons/sound2.gif) | Arctic.wma | 2019-06-02 11:39 | 588K | |
![[SND]](/icons/sound2.gif) | Bamboo Sound.wma | 2019-06-02 11:39 | 588K | |
![[SND]](/icons/sound2.gif) | Certitude.wma | 2019-06-02 11:39 | 588K | |
![[SND]](/icons/sound2.gif) | Clarity.wma | 2019-06-02 11:39 | 588K | |
![[SND]](/icons/sound2.gif) | Clouds.wma | 2019-06-02 11:39 | 588K | |
![[SND]](/icons/sound2.gif) | Dawn.wma | 2019-06-02 11:39 | 588K | |
![[SND]](/icons/sound2.gif) | Misty.wma | 2019-06-02 11:39 | 588K | |
![[SND]](/icons/sound2.gif) | Perception.wma | 2019-06-02 11:39 | 588K | |
![[SND]](/icons/sound2.gif) | Sensual.wma | 2019-06-02 11:39 | 588K | |
![[SND]](/icons/sound2.gif) | Superior.wma | 2019-06-02 11:39 | 588K | |
![[SND]](/icons/sound2.gif) | Wind Passion.wma | 2019-06-02 11:39 | 588K | |
![[SND]](/icons/sound2.gif) | Decor.wma | 2019-06-02 11:39 | 589K | |
![[SND]](/icons/sound2.gif) | Box.wma | 2019-06-02 11:39 | 594K | |
![[SND]](/icons/sound2.gif) | Euphorium.wma | 2019-06-02 11:39 | 594K | |
![[SND]](/icons/sound2.gif) | Fantasy.wma | 2019-06-02 11:39 | 594K | |
![[SND]](/icons/sound2.gif) | India Retro.wma | 2019-06-02 11:39 | 594K | |
![[SND]](/icons/sound2.gif) | Nightclub.wma | 2019-06-02 11:39 | 594K | |
![[SND]](/icons/sound2.gif) | Paw.wma | 2019-06-02 11:39 | 594K | |
![[SND]](/icons/sound2.gif) | Wind Dance.wma | 2019-06-02 11:39 | 594K | |
![[SND]](/icons/sound2.gif) | Affection.wma | 2019-06-02 11:39 | 600K | |
![[SND]](/icons/sound2.gif) | Alablaster.wma | 2019-06-02 11:39 | 600K | |
![[SND]](/icons/sound2.gif) | Futurefare.wma | 2019-06-02 11:39 | 600K | |
![[SND]](/icons/sound2.gif) | Inject.wma | 2019-06-02 11:39 | 600K | |
![[SND]](/icons/sound2.gif) | Leave It.wma | 2019-06-02 11:39 | 600K | |
![[SND]](/icons/sound2.gif) | Mars.wma | 2019-06-02 11:39 | 600K | |
![[SND]](/icons/sound2.gif) | Note.wma | 2019-06-02 11:39 | 600K | |
![[SND]](/icons/sound2.gif) | Pedal.wma | 2019-06-02 11:39 | 600K | |
![[SND]](/icons/sound2.gif) | Pliable.wma | 2019-06-02 11:39 | 600K | |
![[SND]](/icons/sound2.gif) | Rice.wma | 2019-06-02 11:39 | 600K | |
![[SND]](/icons/sound2.gif) | Corporation.wma | 2019-06-02 11:39 | 606K | |
![[SND]](/icons/sound2.gif) | Crunch.wma | 2019-06-02 11:39 | 606K | |
![[SND]](/icons/sound2.gif) | Happy-Go-Lucky.wma | 2019-06-02 11:39 | 606K | |
![[SND]](/icons/sound2.gif) | Horizon.wma | 2019-06-02 11:39 | 606K | |
![[SND]](/icons/sound2.gif) | Leaves on Water.wma | 2019-06-02 11:39 | 606K | |
![[SND]](/icons/sound2.gif) | Lifeform.wma | 2019-06-02 11:39 | 606K | |
![[SND]](/icons/sound2.gif) | Nonetheless.wma | 2019-06-02 11:39 | 606K | |
![[SND]](/icons/sound2.gif) | Rocking India.wma | 2019-06-02 11:39 | 606K | |
![[SND]](/icons/sound2.gif) | Wobbles.wma | 2019-06-02 11:39 | 606K | |
![[SND]](/icons/sound2.gif) | Gradient.wma | 2019-06-02 11:39 | 612K | |
![[SND]](/icons/sound2.gif) | Night Hype.wma | 2019-06-02 11:39 | 612K | |
![[SND]](/icons/sound2.gif) | Nokia Tune (2008).wma | 2019-06-02 11:39 | 612K | |
![[SND]](/icons/sound2.gif) | Sandy Dune.wma | 2019-06-02 11:39 | 612K | |
![[SND]](/icons/sound2.gif) | Today.wma | 2019-06-02 11:39 | 612K | |
![[SND]](/icons/sound2.gif) | Flying Colors.wma | 2019-06-02 11:39 | 618K | |
![[SND]](/icons/sound2.gif) | Xylotron.wma | 2019-06-02 11:39 | 618K | |
![[SND]](/icons/sound2.gif) | Glume.wma | 2019-06-02 11:39 | 618K | |
![[SND]](/icons/sound2.gif) | Airy.wma | 2019-06-02 11:39 | 623K | |
![[SND]](/icons/sound2.gif) | Classic Chap.wma | 2019-06-02 11:39 | 623K | |
![[SND]](/icons/sound2.gif) | Latin Quarter.wma | 2019-06-02 11:39 | 623K | |
![[SND]](/icons/sound2.gif) | Malfunction.wma | 2019-06-02 11:39 | 623K | |
![[SND]](/icons/sound2.gif) | Tarmac.wma | 2019-06-02 11:39 | 623K | |
![[SND]](/icons/sound2.gif) | Vanilla.wma | 2019-06-02 11:39 | 623K | |
![[SND]](/icons/sound2.gif) | Venue.wma | 2019-06-02 11:39 | 623K | |
![[SND]](/icons/sound2.gif) | Welcome.wma | 2019-06-02 11:39 | 623K | |
![[SND]](/icons/sound2.gif) | Aerialist.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Arpeggios.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Bach.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Bold.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Bridge.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Bright-Eyed.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Clock 6 (Zenith).wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Clock 19 (Kalimbas).wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Dance.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Don't Know.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Elephant.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Falls.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Futurism Now.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Lakeside.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Liszt.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Look.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Magnetic Coupling.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Mercurial Beat.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Neon Smile.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Platform Rebel.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Present.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | R'n B.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Seascapes at Noon.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Serenity.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Sing.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Steppre.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Valiant.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Words.wma | 2019-06-02 11:39 | 629K | |
![[SND]](/icons/sound2.gif) | Angklungs.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Archipelago.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Ballerina.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Bamboo String.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Clock 5 (Haste).wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Copper Sound.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Earl's Torch.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Escape.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Goan Adventure.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Jungle.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Lover.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Roadie.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Run Before You Walk.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Shadow.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Trapeze.wma | 2019-06-02 11:39 | 635K | |
![[SND]](/icons/sound2.gif) | Pretty.wma | 2019-06-02 11:39 | 647K | |
|